The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-(2-((2-Aminoethyl)disulfanyl)ethoxy)-5-(2-((2-hydroxy-3-(4-(1-methyl-4-(trifluoromethyl)-1H-imidazol-2-yl)phenoxy)propyl)amino)ethoxy)benzamide ID: ALA4443911
PubChem CID: 155516656
Max Phase: Preclinical
Molecular Formula: C27H34F3N5O5S2
Molecular Weight: 629.73
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cn1cc(C(F)(F)F)nc1-c1ccc(OC[C@@H](O)CNCCOc2ccc(OCCSSCCN)c(C(N)=O)c2)cc1
Standard InChI: InChI=1S/C27H34F3N5O5S2/c1-35-16-24(27(28,29)30)34-26(35)18-2-4-20(5-3-18)40-17-19(36)15-33-9-10-38-21-6-7-23(22(14-21)25(32)37)39-11-13-42-41-12-8-31/h2-7,14,16,19,33,36H,8-13,15,17,31H2,1H3,(H2,32,37)/t19-/m0/s1
Standard InChI Key: VFIGQPOLOHYAJG-IBGZPJMESA-N
Molfile:
RDKit 2D
42 44 0 0 0 0 0 0 0 0999 V2000
5.4603 -26.3647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1680 -25.9561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8757 -26.3647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5834 -25.9561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2912 -26.3647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5834 -25.1389 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9989 -25.9561 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7066 -26.3647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4143 -25.9561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7531 -25.9532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0458 -26.3611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0454 -27.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7581 -27.5876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4624 -27.1774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3407 -27.5926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5937 -27.2613 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0477 -27.8693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4573 -28.5765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2563 -28.4054 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8644 -28.9514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2349 -27.7849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9015 -27.0388 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.7554 -28.4467 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.1220 -26.3647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8297 -25.9561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5364 -26.3686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2436 -25.9607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2441 -25.1426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5314 -24.7342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8271 -25.1444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9512 -26.3696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6591 -25.9614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9508 -27.1868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9513 -24.7331 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6595 -25.1407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3667 -24.7312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4416 -27.5699 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.0749 -25.1388 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.7821 -24.7293 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.4903 -25.1370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1975 -24.7274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9058 -25.1351 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
4 6 1 1
5 7 1 0
7 8 1 0
8 9 1 0
1 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 1 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 15 1 0
12 15 1 0
19 20 1 0
17 21 1 0
21 22 1 0
21 23 1 0
9 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
27 31 1 0
31 32 1 0
31 33 2 0
28 34 1 0
34 35 1 0
35 36 1 0
21 37 1 0
36 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 629.73Molecular Weight (Monoisotopic): 629.1953AlogP: 3.33#Rotatable Bonds: 18Polar Surface Area: 146.88Molecular Species: BASEHBA: 11HBD: 4#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.20CX Basic pKa: 9.61CX LogP: 2.42CX LogD: -1.11Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.12Np Likeness Score: -0.78
References 1. Schwalbe T, Huebner H, Gmeiner P.. (2019) Development of covalent antagonists for β1- and β2-adrenergic receptors., 27 (13): [PMID:31151791 ] [10.1016/j.bmc.2019.05.034 ]