The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4444206
PubChem CID: 134163557
Max Phase: Preclinical
Molecular Formula: C25H25N5O3
Molecular Weight: 443.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)c1c(C(N)=O)nc2n1C1CC(C1)c1ccc(C#CC(C)(C)c3ncc(C)o3)cc1-2
Standard InChI: InChI=1S/C25H25N5O3/c1-13-12-28-24(33-13)25(2,3)8-7-14-5-6-17-15-10-16(11-15)30-20(23(32)27-4)19(21(26)31)29-22(30)18(17)9-14/h5-6,9,12,15-16H,10-11H2,1-4H3,(H2,26,31)(H,27,32)
Standard InChI Key: BVQAJAHFWBYNPF-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
17.7727 -13.3404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2816 -13.9916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1075 -13.9974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4488 -12.5551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6298 -13.3602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4162 -13.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0222 -13.0447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8365 -12.2372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0505 -11.9968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9659 -12.5329 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7101 -12.1899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6138 -11.3761 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.8100 -11.2162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4097 -11.9312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4645 -10.4670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9407 -9.7932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6429 -10.3915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6505 -13.2212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4403 -11.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0471 -11.1100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6510 -10.5479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2283 -9.8502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0876 -9.8467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5905 -12.0283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0968 -11.3672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2648 -12.7862 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4455 -12.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3413 -10.9883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3954 -11.8053 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.1881 -12.0107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6285 -11.3203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1080 -10.6883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.4519 -11.2704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11 4 1 0
10 1 1 0
1 2 1 0
5 3 1 0
2 3 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 10 1 0
13 15 1 0
15 16 1 0
15 17 2 0
1 18 1 0
18 3 1 0
8 19 1 0
19 20 3 0
20 21 1 0
21 22 1 0
21 23 1 0
14 24 1 0
24 25 2 0
24 26 1 0
26 27 1 0
21 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 28 1 0
31 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 443.51Molecular Weight (Monoisotopic): 443.1957AlogP: 3.07#Rotatable Bonds: 3Polar Surface Area: 116.04Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.26CX Basic pKa: 1.26CX LogP: 2.36CX LogD: 2.36Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.60Np Likeness Score: -0.64
References 1. Feng JA, Lee P, Alaoui MH, Barrett K, Castanedo G, Godemann R, McEwan P, Wang X, Wu P, Zhang Y, Harris SF, Staben ST.. (2019) Structure Based Design of Potent Selective Inhibitors of Protein Kinase D1 (PKD1)., 10 (9): [PMID:31531194 ] [10.1021/acsmedchemlett.8b00658 ]