The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(4-methoxyphenylsulfonyl)piperazin-1-yl)-6-methylquinoline-3-carbonitrile ID: ALA4444246
PubChem CID: 3214072
Max Phase: Preclinical
Molecular Formula: C22H22N4O3S
Molecular Weight: 422.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(=O)(=O)N2CCN(c3nc4ccc(C)cc4cc3C#N)CC2)cc1
Standard InChI: InChI=1S/C22H22N4O3S/c1-16-3-8-21-17(13-16)14-18(15-23)22(24-21)25-9-11-26(12-10-25)30(27,28)20-6-4-19(29-2)5-7-20/h3-8,13-14H,9-12H2,1-2H3
Standard InChI Key: QIWICSQKMCMGIS-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
22.1013 -12.3198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6968 -11.6140 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.2879 -12.3172 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0370 -9.1789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0358 -9.9985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7439 -10.4074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7421 -8.7701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4507 -9.1753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4515 -9.9943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1600 -10.4014 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8683 -9.9906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8635 -9.1684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1544 -8.7651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5776 -10.3964 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5686 -8.7587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2738 -8.3458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5765 -11.2101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2817 -11.6159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9902 -11.2080 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9890 -10.3899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2792 -9.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4056 -11.2079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1114 -11.6171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8185 -11.2091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8189 -10.3911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1062 -9.9827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4019 -10.3931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5260 -9.9815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.2343 -10.3891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3292 -8.7705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
11 14 1 0
15 16 3 0
12 15 1 0
14 17 1 0
14 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
19 2 1 0
2 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
28 29 1 0
4 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 422.51Molecular Weight (Monoisotopic): 422.1413AlogP: 2.93#Rotatable Bonds: 4Polar Surface Area: 86.53Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.27CX LogP: 3.73CX LogD: 3.73Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.64Np Likeness Score: -1.88
References 1. Spanò V, Montalbano A, Carbone A, Scudieri P, Galietta LJV, Barraja P.. (2019) An overview on chemical structures as ΔF508-CFTR correctors., 180 [PMID:31326599 ] [10.1016/j.ejmech.2019.07.037 ] 2. Spanò V, Venturini A, Genovese M, Barreca M, Raimondi MV, Montalbano A, Galietta LJV, Barraja P.. (2020) Current development of CFTR potentiators in the last decade., 204 [PMID:32898816 ] [10.1016/j.ejmech.2020.112631 ]