The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-ethyl 2-((E)-((2-(allylthio)-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methylene)hydrazono)-3-(4-hydroxyphenyl)-4-methyl-2,3-dihydrothiazole-5-carboxylate ID: ALA4444305
PubChem CID: 155516954
Max Phase: Preclinical
Molecular Formula: C27H24N6O3S3
Molecular Weight: 576.73
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CCSc1nn2c(/C=N/N=c3\sc(C(=O)OCC)c(C)n3-c3ccc(O)cc3)c(-c3ccccc3)nc2s1
Standard InChI: InChI=1S/C27H24N6O3S3/c1-4-15-37-27-31-33-21(22(29-25(33)39-27)18-9-7-6-8-10-18)16-28-30-26-32(19-11-13-20(34)14-12-19)17(3)23(38-26)24(35)36-5-2/h4,6-14,16,34H,1,5,15H2,2-3H3/b28-16+,30-26-
Standard InChI Key: NGGHBLULEHOHAJ-KECITLTASA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
33.7655 -8.0215 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.7471 -6.6790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2747 -7.3571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5406 -6.9241 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.5497 -7.7522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3404 -8.0023 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
35.8215 -7.3261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3256 -6.6607 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.4514 -7.3696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0261 -6.6561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1988 -6.6672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7960 -7.3911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2223 -8.1053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0481 -8.0907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4808 -5.8951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6683 -5.7359 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.4019 -4.9521 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.5938 -4.7916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2476 -4.0466 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.4294 -4.1437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2689 -4.9519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9879 -5.3541 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
31.6467 -3.3276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4716 -3.3169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8730 -2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4504 -1.8898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6224 -1.9046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2248 -2.6239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8509 -1.1772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.8700 -3.5389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6454 -7.3169 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
37.0653 -8.0259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8892 -8.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3090 -8.7256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5198 -5.2976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4447 -6.1192 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8459 -4.8217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.0968 -5.1674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4229 -4.6915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 5 2 0
4 2 1 0
2 3 2 0
3 1 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 4 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
3 9 1 0
2 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 18 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
19 23 1 0
26 29 1 0
20 30 1 0
7 31 1 0
31 32 1 0
32 33 1 0
33 34 2 0
21 35 1 0
35 36 2 0
35 37 1 0
37 38 1 0
38 39 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 576.73Molecular Weight (Monoisotopic): 576.1072AlogP: 5.71#Rotatable Bonds: 9Polar Surface Area: 106.37Molecular Species: NEUTRALHBA: 12HBD: 1#RO5 Violations: 3HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.88CX Basic pKa: 1.68CX LogP: 7.20CX LogD: 7.19Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.08Np Likeness Score: -1.44
References 1. Kryshchyshyn A, Kaminskyy D, Karpenko O, Gzella A, Grellier P, Lesyk R.. (2019) Thiazolidinone/thiazole based hybrids - New class of antitrypanosomal agents., 174 [PMID:31051403 ] [10.1016/j.ejmech.2019.04.052 ]