(Z)-ethyl 2-((E)-((2-(allylthio)-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methylene)hydrazono)-3-(4-hydroxyphenyl)-4-methyl-2,3-dihydrothiazole-5-carboxylate

ID: ALA4444305

PubChem CID: 155516954

Max Phase: Preclinical

Molecular Formula: C27H24N6O3S3

Molecular Weight: 576.73

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=CCSc1nn2c(/C=N/N=c3\sc(C(=O)OCC)c(C)n3-c3ccc(O)cc3)c(-c3ccccc3)nc2s1

Standard InChI:  InChI=1S/C27H24N6O3S3/c1-4-15-37-27-31-33-21(22(29-25(33)39-27)18-9-7-6-8-10-18)16-28-30-26-32(19-11-13-20(34)14-12-19)17(3)23(38-26)24(35)36-5-2/h4,6-14,16,34H,1,5,15H2,2-3H3/b28-16+,30-26-

Standard InChI Key:  NGGHBLULEHOHAJ-KECITLTASA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   33.7655   -8.0215    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.7471   -6.6790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2747   -7.3571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5406   -6.9241    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.5497   -7.7522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3404   -8.0023    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   35.8215   -7.3261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3256   -6.6607    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.4514   -7.3696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0261   -6.6561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1988   -6.6672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7960   -7.3911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2223   -8.1053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0481   -8.0907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4808   -5.8951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6683   -5.7359    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.4019   -4.9521    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.5938   -4.7916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2476   -4.0466    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.4294   -4.1437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2689   -4.9519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9879   -5.3541    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   31.6467   -3.3276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4716   -3.3169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8730   -2.5981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4504   -1.8898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6224   -1.9046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2248   -2.6239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8509   -1.1772    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.8700   -3.5389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6454   -7.3169    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   37.0653   -8.0259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8892   -8.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3090   -8.7256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5198   -5.2976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4447   -6.1192    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.8459   -4.8217    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.0968   -5.1674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4229   -4.6915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  5  2  0
  4  2  1  0
  2  3  2  0
  3  1  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  4  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  3  9  1  0
  2 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 18  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 19 23  1  0
 26 29  1  0
 20 30  1  0
  7 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  2  0
 21 35  1  0
 35 36  2  0
 35 37  1  0
 37 38  1  0
 38 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4444305

    ---

Associated Targets(non-human)

Trypanosoma brucei gambiense (523 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 576.73Molecular Weight (Monoisotopic): 576.1072AlogP: 5.71#Rotatable Bonds: 9
Polar Surface Area: 106.37Molecular Species: NEUTRALHBA: 12HBD: 1
#RO5 Violations: 3HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.88CX Basic pKa: 1.68CX LogP: 7.20CX LogD: 7.19
Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.08Np Likeness Score: -1.44

References

1. Kryshchyshyn A, Kaminskyy D, Karpenko O, Gzella A, Grellier P, Lesyk R..  (2019)  Thiazolidinone/thiazole based hybrids - New class of antitrypanosomal agents.,  174  [PMID:31051403] [10.1016/j.ejmech.2019.04.052]

Source