The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(2-fluorobenzoyl)piperazin-1-yl)-6-methoxyquinoline-3-carbonitrile ID: ALA4444352
PubChem CID: 71110482
Max Phase: Preclinical
Molecular Formula: C22H19FN4O2
Molecular Weight: 390.42
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2nc(N3CCN(C(=O)c4ccccc4F)CC3)c(C#N)cc2c1
Standard InChI: InChI=1S/C22H19FN4O2/c1-29-17-6-7-20-15(13-17)12-16(14-24)21(25-20)26-8-10-27(11-9-26)22(28)18-4-2-3-5-19(18)23/h2-7,12-13H,8-11H2,1H3
Standard InChI Key: URSZYPJNFJDXKN-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
37.9746 -11.2384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3148 -8.8033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3136 -9.6229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0217 -10.0318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0199 -8.3945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7285 -8.7997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7293 -9.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4378 -10.0258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.1461 -9.6150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1413 -8.7929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4322 -8.3895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8554 -10.0208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.8464 -8.3831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5516 -7.9703 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.8542 -10.8345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5595 -11.2403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2680 -10.8324 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.2668 -10.0143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5570 -9.6040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6834 -10.8323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3891 -11.2416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0963 -10.8336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0967 -10.0155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3840 -9.6071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6797 -10.0175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6070 -8.3949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.6068 -7.5777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9742 -12.0556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.3882 -12.0588 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 7 2 0
6 5 2 0
5 2 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
9 12 1 0
13 14 3 0
10 13 1 0
12 15 1 0
12 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
17 1 1 0
1 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
2 26 1 0
26 27 1 0
1 28 2 0
21 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 390.42Molecular Weight (Monoisotopic): 390.1492AlogP: 3.22#Rotatable Bonds: 3Polar Surface Area: 69.46Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.22CX LogP: 3.60CX LogD: 3.60Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.69Np Likeness Score: -1.90
References 1. Spanò V, Montalbano A, Carbone A, Scudieri P, Galietta LJV, Barraja P.. (2019) An overview on chemical structures as ΔF508-CFTR correctors., 180 [PMID:31326599 ] [10.1016/j.ejmech.2019.07.037 ] 2. Spanò V, Venturini A, Genovese M, Barreca M, Raimondi MV, Montalbano A, Galietta LJV, Barraja P.. (2020) Current development of CFTR potentiators in the last decade., 204 [PMID:32898816 ] [10.1016/j.ejmech.2020.112631 ]