The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(7-(4-(pyridin-3-yl)-1H-1,2,3-triazol-1-yl)heptyl)-2-(1H-1,2,3-triazol-4-yl)benzamide ID: ALA4444551
PubChem CID: 155517553
Max Phase: Preclinical
Molecular Formula: C23H26N8O
Molecular Weight: 430.52
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCCCCCCCn1cc(-c2cccnc2)nn1)c1ccccc1-c1c[nH]nn1
Standard InChI: InChI=1S/C23H26N8O/c32-23(20-11-5-4-10-19(20)21-16-26-29-27-21)25-13-6-2-1-3-7-14-31-17-22(28-30-31)18-9-8-12-24-15-18/h4-5,8-12,15-17H,1-3,6-7,13-14H2,(H,25,32)(H,26,27,29)
Standard InChI Key: ARLUKNRNWYNZQU-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
16.6946 -27.9139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5100 -27.9150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9169 -27.2105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5095 -26.5044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6910 -26.5073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2878 -27.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7373 -27.2076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2174 -27.8688 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.9947 -27.6164 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.9949 -26.7992 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2178 -26.5466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6981 -26.3854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4091 -26.7881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1134 -26.3736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8245 -26.7763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5288 -26.3618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2399 -26.7645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9442 -26.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6552 -26.7527 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.3595 -26.3382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0706 -26.7409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3527 -25.5210 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.0746 -27.5586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7848 -27.9612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4901 -27.5466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4806 -26.7253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7698 -26.3264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7584 -25.5123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4066 -25.0248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1443 -24.2541 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.3301 -24.2654 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.0895 -25.0432 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 7 2 0
3 7 1 0
10 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 21 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 1 0
31 32 2 0
32 28 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.52Molecular Weight (Monoisotopic): 430.2230AlogP: 3.51#Rotatable Bonds: 11Polar Surface Area: 114.27Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.71CX Basic pKa: 4.08CX LogP: 3.58CX LogD: 3.58Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.35Np Likeness Score: -1.54
References 1. Travelli C, Aprile S, Mattoteia D, Colombo G, Clemente N, Scanziani E, Terrazzino S, Alisi MA, Polenzani L, Grosa G, Genazzani AA, Tron GC, Galli U.. (2019) Identification of potent triazolylpyridine nicotinamide phosphoribosyltransferase (NAMPT) inhibitors bearing a 1,2,3-triazole tail group., 181 [PMID:31400709 ] [10.1016/j.ejmech.2019.111576 ]