The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-chlorobenzyl)-5-methyl-N-(2-(trifluoromethyl)benzyl)-1H-imidazole-4-carboxamide ID: ALA4444666
PubChem CID: 142499512
Max Phase: Preclinical
Molecular Formula: C20H17ClF3N3O
Molecular Weight: 407.82
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(C(=O)NCc2ccccc2C(F)(F)F)ncn1Cc1ccc(Cl)cc1
Standard InChI: InChI=1S/C20H17ClF3N3O/c1-13-18(26-12-27(13)11-14-6-8-16(21)9-7-14)19(28)25-10-15-4-2-3-5-17(15)20(22,23)24/h2-9,12H,10-11H2,1H3,(H,25,28)
Standard InChI Key: PGZJQODJZPHLAK-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
15.7058 -15.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3637 -16.2480 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9621 -16.8046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6763 -16.4075 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5193 -15.6055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4174 -16.7518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0862 -16.2822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8267 -16.6291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4950 -16.1602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4231 -15.3453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6771 -15.0016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0118 -15.4725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0912 -14.8748 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
17.0760 -15.0073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3078 -14.7925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7269 -14.0910 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4907 -14.7803 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0927 -14.0666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2756 -14.0543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8823 -13.3381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0659 -13.3256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6460 -14.0276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0483 -14.7438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8633 -14.7528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3038 -12.6380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1208 -12.6530 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.9082 -11.9229 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.7065 -11.9277 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 1 2 0
4 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
10 13 1 0
5 14 1 0
1 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
20 25 1 0
25 26 1 0
25 27 1 0
25 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 407.82Molecular Weight (Monoisotopic): 407.1012AlogP: 4.84#Rotatable Bonds: 5Polar Surface Area: 46.92Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.90CX LogP: 4.67CX LogD: 4.67Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.66Np Likeness Score: -1.73
References 1. (2018) Compositions and methods for treating g protein coupled receptor mediated conditions,