The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-((S)-1-(2-chlorophenyl)-2-(3,3-difluorocyclobutylamino)-2-oxoethyl)-1-(4-cyanopyridin-2-yl)-N-(3,5-difluorophenyl)-5-oxopyrrolidine-2-carboxamide ID: ALA4444886
Cas Number: 1448346-43-7
PubChem CID: 89699884
Max Phase: Preclinical
Molecular Formula: C29H22ClF4N5O3
Molecular Weight: 599.97
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1ccnc(N2C(=O)CC[C@H]2C(=O)N(c2cc(F)cc(F)c2)[C@H](C(=O)NC2CC(F)(F)C2)c2ccccc2Cl)c1
Standard InChI: InChI=1S/C29H22ClF4N5O3/c30-22-4-2-1-3-21(22)26(27(41)37-19-13-29(33,34)14-19)38(20-11-17(31)10-18(32)12-20)28(42)23-5-6-25(40)39(23)24-9-16(15-35)7-8-36-24/h1-4,7-12,19,23,26H,5-6,13-14H2,(H,37,41)/t23-,26-/m0/s1
Standard InChI Key: KICQCOSIQLKQBA-OZXSUGGESA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
25.7704 -11.0114 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26.5876 -11.0156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1826 -10.3058 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.7160 -12.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4238 -11.5934 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.0083 -11.5934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7160 -12.8192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0083 -10.7762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.3006 -12.0020 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.5929 -11.5934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3796 -10.8046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8018 -11.8054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0060 -13.2259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0057 -14.0423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7139 -14.4518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4240 -14.0388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4208 -13.2237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2991 -12.8160 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
31.1315 -12.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4238 -10.7762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1315 -12.8192 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.8392 -11.5934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1347 -10.3711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1351 -9.5547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4268 -9.1453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7168 -9.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7199 -10.3734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8430 -9.1465 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.0076 -9.1522 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.5858 -11.9208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.1326 -11.3135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7240 -10.6058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9247 -10.7758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9453 -11.3990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.7597 -12.7161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1522 -13.2643 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.3238 -14.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1024 -14.3136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7095 -13.7603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5348 -12.9641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4871 -14.0074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2659 -14.2550 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
4 6 1 0
4 7 1 1
6 8 2 0
6 9 1 0
9 10 1 0
10 11 1 0
11 2 1 0
2 12 1 0
12 10 1 0
7 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 7 1 0
13 18 1 0
5 19 1 0
5 20 1 0
19 21 2 0
22 19 1 6
20 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 20 1 0
24 28 1 0
26 29 1 0
22 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 22 1 0
31 34 2 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
30 35 1 0
41 42 3 0
39 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 599.97Molecular Weight (Monoisotopic): 599.1347AlogP: 5.07#Rotatable Bonds: 7Polar Surface Area: 106.40Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.15CX Basic pKa: ┄CX LogP: 4.37CX LogD: 4.37Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.38Np Likeness Score: -1.47
References 1. Ma T, Zou F, Pusch S, Xu Y, von Deimling A, Zha X.. (2018) Inhibitors of Mutant Isocitrate Dehydrogenases 1 and 2 (mIDH1/2): An Update and Perspective., 61 (20): [PMID:29847930 ] [10.1021/acs.jmedchem.8b00159 ]