The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-(1-(9H-purin-6-yl)pyrrolidin-2-yl)-3-cyclopentyl-5-fluoroquinazolin-4(3H)-one ID: ALA4445029
PubChem CID: 155517381
Max Phase: Preclinical
Molecular Formula: C22H22FN7O
Molecular Weight: 419.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=c1c2c(F)cccc2nc([C@@H]2CCCN2c2ncnc3[nH]cnc23)n1C1CCCC1
Standard InChI: InChI=1S/C22H22FN7O/c23-14-7-3-8-15-17(14)22(31)30(13-5-1-2-6-13)20(28-15)16-9-4-10-29(16)21-18-19(25-11-24-18)26-12-27-21/h3,7-8,11-13,16H,1-2,4-6,9-10H2,(H,24,25,26,27)/t16-/m0/s1
Standard InChI Key: WKDYVBNGHSQMDN-INIZCTEOSA-N
Molfile:
RDKit 2D
31 36 0 0 0 0 0 0 0 0999 V2000
27.2618 -7.5396 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.0373 -7.8135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5380 -7.1602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0673 -6.4821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2821 -6.7197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7260 -5.4892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7249 -6.3128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4370 -6.7218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4353 -5.0762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1480 -5.4856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1468 -6.3103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8572 -6.7194 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.5732 -6.3123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5743 -5.4876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.8595 -5.0699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8595 -4.2485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.5505 -7.9449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8437 -7.5224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1287 -7.9271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1200 -8.7487 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.5444 -8.7612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0021 -9.9606 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.8116 -10.0486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1441 -9.3057 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.8282 -9.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4328 -4.2549 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.2823 -5.0787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0270 -5.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5740 -4.8049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1651 -4.0968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3655 -4.2670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
6 7 2 0
7 8 1 0
8 11 2 0
10 9 2 0
9 6 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 2 0
5 13 1 6
1 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
21 17 1 0
21 25 2 0
25 22 1 0
22 23 1 0
23 24 2 0
24 21 1 0
20 25 1 0
9 26 1 0
14 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 419.46Molecular Weight (Monoisotopic): 419.1870AlogP: 3.66#Rotatable Bonds: 3Polar Surface Area: 92.59Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.83CX Basic pKa: 3.83CX LogP: 3.22CX LogD: 3.22Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.54Np Likeness Score: -0.96
References 1. Ma X, Fang F, Tao Q, Shen L, Zhong G, Qiao T, Lv X, Li J.. (2019) Conformationally restricted quinazolone derivatives as PI3Kδ-selective inhibitors: the design, synthesis and biological evaluation., 10 (3): [PMID:30996859 ] [10.1039/C8MD00556G ]