N,N'-(dodecane-1,12-diyl)bis(N'-hydroxybenzimidamide)

ID: ALA4445478

PubChem CID: 155517993

Max Phase: Preclinical

Molecular Formula: C26H38N4O2

Molecular Weight: 438.62

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O/N=C(\NCCCCCCCCCCCCN/C(=N\O)c1ccccc1)c1ccccc1

Standard InChI:  InChI=1S/C26H38N4O2/c31-29-25(23-17-11-9-12-18-23)27-21-15-7-5-3-1-2-4-6-8-16-22-28-26(30-32)24-19-13-10-14-20-24/h9-14,17-20,31-32H,1-8,15-16,21-22H2,(H,27,29)(H,28,30)

Standard InChI Key:  DETHYPCFGVXBDX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 33  0  0  0  0  0  0  0  0999 V2000
    1.1319   -2.9958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1307   -3.8232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8456   -4.2360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5620   -3.8227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5591   -2.9921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8437   -2.5830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2721   -2.5770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9880   -2.9868    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2689   -1.7520    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9819   -1.3368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7010   -2.5715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4170   -2.9814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1299   -2.5662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8459   -2.9760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5588   -2.5608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2748   -2.9706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9878   -2.5554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7038   -2.9653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4167   -2.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1328   -2.9598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8456   -2.5447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5617   -2.9545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2745   -2.5392    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.9906   -2.9491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7034   -2.5339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9937   -3.7741    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2808   -4.1892    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4189   -2.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1314   -2.5313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1286   -1.7054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4076   -1.2958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6981   -1.7126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  9 10  1  0
  8 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  2  0
 26 27  1  0
 25 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4445478

    ---

Associated Targets(non-human)

Plasmodium vinckei petteri (380 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 438.62Molecular Weight (Monoisotopic): 438.2995AlogP: 5.74#Rotatable Bonds: 15
Polar Surface Area: 89.24Molecular Species: NEUTRALHBA: 4HBD: 4
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.86CX Basic pKa: 5.24CX LogP: 6.30CX LogD: 6.28
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.09Np Likeness Score: -0.23

References

1. Berger O, Ortial S, Wein S, Denoyelle S, Bressolle F, Durand T, Escale R, Vial HJ, Vo-Hoang Y..  (2019)  Evaluation of amidoxime derivatives as prodrug candidates of potent bis-cationic antimalarials.,  29  (16): [PMID:31255483] [10.1016/j.bmcl.2019.06.045]

Source