The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-2-(5-((6-(4-Fluorobenzyloxy)naphthalen-2-yl)methylene)-4-oxo-2-thioxothiazolidin-3-yl)-3-(1H-indol-3-yl)propanoic acid ID: ALA4445615
PubChem CID: 155517773
Max Phase: Preclinical
Molecular Formula: C32H23FN2O4S2
Molecular Weight: 582.68
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)C(Cc1c[nH]c2ccccc12)N1C(=O)/C(=C/c2ccc3cc(OCc4ccc(F)cc4)ccc3c2)SC1=S
Standard InChI: InChI=1S/C32H23FN2O4S2/c33-24-10-6-19(7-11-24)18-39-25-12-9-21-13-20(5-8-22(21)15-25)14-29-30(36)35(32(40)41-29)28(31(37)38)16-23-17-34-27-4-2-1-3-26(23)27/h1-15,17,28,34H,16,18H2,(H,37,38)/b29-14-
Standard InChI Key: SDBKLCSBUDBMGQ-NUJZUDFISA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
32.7812 -14.1522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7800 -14.9718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4881 -15.3807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4863 -13.7434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1949 -14.1486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1956 -14.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9042 -15.3747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6124 -14.9639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6077 -14.1418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8986 -13.7384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0734 -13.7438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.3217 -15.3697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0279 -14.9584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7719 -15.2896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3163 -14.6802 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.9050 -13.9740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1063 -14.1471 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
38.2344 -13.2261 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
37.9434 -16.0886 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.1294 -14.7624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4647 -15.5077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6071 -14.0994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4202 -14.1817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8269 -14.8876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6255 -14.7146 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.9599 -13.5722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7050 -13.9009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3601 -13.4204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2714 -12.6111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5219 -12.2847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8700 -12.7673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9894 -16.1722 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.2802 -15.5915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.3657 -14.1526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6579 -13.7441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6614 -12.9264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9544 -12.5180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2458 -12.9268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2486 -13.7482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9562 -14.1529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5375 -12.5193 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
1 11 1 0
8 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 13 1 0
16 18 2 0
14 19 2 0
15 20 1 0
20 21 1 0
20 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 27 1 0
26 23 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
21 32 1 0
21 33 2 0
11 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
38 41 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 582.68Molecular Weight (Monoisotopic): 582.1083AlogP: 6.94#Rotatable Bonds: 8Polar Surface Area: 82.63Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.96CX Basic pKa: ┄CX LogP: 7.46CX LogD: 4.28Aromatic Rings: 5Heavy Atoms: 41QED Weighted: 0.15Np Likeness Score: -1.01
References 1. Liu H, Sun D, Du H, Zheng C, Li J, Piao H, Li J, Sun L.. (2019) Synthesis and biological evaluation of tryptophan-derived rhodanine derivatives as PTP1B inhibitors and anti-bacterial agents., 172 [PMID:30978561 ] [10.1016/j.ejmech.2019.03.059 ]