N-(5-Methyl-3-phenylisoxazol-4-yl)-4-(4-methylpiperazin-1-yl)benzamide

ID: ALA4445678

PubChem CID: 155517810

Max Phase: Preclinical

Molecular Formula: C22H24N4O2

Molecular Weight: 376.46

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1onc(-c2ccccc2)c1NC(=O)c1ccc(N2CCN(C)CC2)cc1

Standard InChI:  InChI=1S/C22H24N4O2/c1-16-20(21(24-28-16)17-6-4-3-5-7-17)23-22(27)18-8-10-19(11-9-18)26-14-12-25(2)13-15-26/h3-11H,12-15H2,1-2H3,(H,23,27)

Standard InChI Key:  SATSHXJCDQALIO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   15.4586  -20.2815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.4537  -21.1028    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2329  -21.3619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7232  -20.7019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2410  -20.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4960  -19.2612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2976  -19.0971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5548  -18.3222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0113  -17.7108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2074  -17.8794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9540  -18.6541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4786  -22.1412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5404  -20.7068    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.9447  -21.4170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7619  -21.4219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1640  -22.1327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9804  -22.1380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3941  -21.4323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9854  -20.7197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1703  -20.7179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2113  -21.4361    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.6165  -22.1458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6232  -20.7304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4404  -20.7342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8456  -21.4438    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.4337  -22.1496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6628  -21.4477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5318  -22.1222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  2  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  5  6  1  0
  3 12  1  0
  4 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 18 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 22 26  1  0
 25 27  1  0
 14 28  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4445678

    ---

Associated Targets(non-human)

Gata4 GATA4/NKX2-5 (206 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 376.46Molecular Weight (Monoisotopic): 376.1899AlogP: 3.65#Rotatable Bonds: 4
Polar Surface Area: 61.61Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.33CX Basic pKa: 7.74CX LogP: 3.62CX LogD: 3.11
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.75Np Likeness Score: -1.59

References

1. Jumppanen M, Kinnunen SM, Välimäki MJ, Talman V, Auno S, Bruun T, Boije Af Gennäs G, Xhaard H, Aumüller IB, Ruskoaho H, Yli-Kauhaluoma J..  (2019)  Synthesis, Identification, and Structure-Activity Relationship Analysis of GATA4 and NKX2-5 Protein-Protein Interaction Modulators.,  62  (17): [PMID:31431011] [10.1021/acs.jmedchem.9b01086]

Source