The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N'-(4-ethoxybenzylidene)-2-(3-(3-(2-(2-(4-ethoxyphenyl)ethylidene)hydrazinyl)-2-oxopropylthio)-5H-[1,2,4]triazino[5,6-b]indol-5-yl)acetohydrazide ID: ALA4445766
PubChem CID: 155517791
Max Phase: Preclinical
Molecular Formula: C33H34N8O4S
Molecular Weight: 638.75
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1ccc(/C=N/NC(=O)Cn2c3ccccc3c3nnc(SCC(=O)CN/N=C/Cc4ccc(OCC)cc4)nc32)cc1
Standard InChI: InChI=1S/C33H34N8O4S/c1-3-44-26-13-9-23(10-14-26)17-18-34-35-20-25(42)22-46-33-37-32-31(39-40-33)28-7-5-6-8-29(28)41(32)21-30(43)38-36-19-24-11-15-27(16-12-24)45-4-2/h5-16,18-19,35H,3-4,17,20-22H2,1-2H3,(H,38,43)/b34-18+,36-19+
Standard InChI Key: AHNOKWFRJSAUKD-KFFYWHIPSA-N
Molfile:
RDKit 2D
46 50 0 0 0 0 0 0 0 0999 V2000
5.8400 -4.8577 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1771 -4.3798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4333 -3.6015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8879 -2.9925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0862 -3.1606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8328 -3.9431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3799 -4.5488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2486 -3.5990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5012 -4.3776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3002 -4.5469 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8474 -3.9384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5901 -3.1580 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7917 -2.9925 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8414 -5.6749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5499 -6.0823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5513 -6.8995 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2569 -5.6724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2597 -7.3068 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9667 -6.8970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6751 -7.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6631 -3.9374 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.0708 -3.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8880 -3.2281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2957 -2.5199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2974 -3.9353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1146 -3.9343 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5241 -4.6415 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3413 -4.6405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7508 -5.3477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5680 -5.3467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6741 -8.1193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3817 -8.5266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0897 -8.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0856 -7.2953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3774 -6.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9731 -6.0554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7896 -6.0547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1981 -5.3460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7842 -4.6364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9691 -4.6406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7986 -8.5232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8011 -9.3404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5101 -9.7468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0153 -5.3439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4257 -6.0505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2429 -6.0484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 9 1 0
8 3 1 0
2 1 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
1 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
16 18 1 0
18 19 2 0
19 20 1 0
11 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
23 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 1 0
20 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 20 1 0
30 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 30 1 0
33 41 1 0
41 42 1 0
42 43 1 0
38 44 1 0
44 45 1 0
45 46 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 638.75Molecular Weight (Monoisotopic): 638.2424AlogP: 4.41#Rotatable Bonds: 16Polar Surface Area: 144.98Molecular Species: NEUTRALHBA: 12HBD: 2#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.66CX Basic pKa: 3.45CX LogP: 4.27CX LogD: 4.27Aromatic Rings: 5Heavy Atoms: 46QED Weighted: 0.09Np Likeness Score: -1.42
References 1. Liu H, Long S, Rakesh KP, Zha GF.. (2020) Structure-activity relationships (SAR) of triazine derivatives: Promising antimicrobial agents., 185 [PMID:31675510 ] [10.1016/j.ejmech.2019.111804 ]