Ethyl 4-(8-Fluoro-2-(4-isopropylpiperazin-1-yl)-4-oxoquinazolin-3(4H)-yl)-benzoate

ID: ALA4446036

PubChem CID: 155518133

Max Phase: Preclinical

Molecular Formula: C24H27FN4O3

Molecular Weight: 438.50

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1ccc(-n2c(N3CCN(C(C)C)CC3)nc3c(F)cccc3c2=O)cc1

Standard InChI:  InChI=1S/C24H27FN4O3/c1-4-32-23(31)17-8-10-18(11-9-17)29-22(30)19-6-5-7-20(25)21(19)26-24(29)28-14-12-27(13-15-28)16(2)3/h5-11,16H,4,12-15H2,1-3H3

Standard InChI Key:  CLMZPLJGQVBNLI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   20.4696   -9.0180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4685   -9.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1765  -10.2465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1747   -8.6091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8834   -9.0144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8868   -9.8396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5991  -10.2470    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.3127   -9.8337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3093   -9.0085    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.5924   -8.5966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5879   -7.7794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0147   -8.5981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7240   -9.0062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4299   -8.5961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4278   -7.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7139   -7.3718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0108   -7.7842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0215  -10.2404    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.0206  -11.0577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7254  -11.4643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4344  -11.0573    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.4341  -10.2391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7249   -9.8280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1417  -11.4666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1751  -11.0636    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.1363   -7.3637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8458   -7.7691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.1327   -6.5465    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.5517   -7.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2612   -7.7629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1408  -12.2838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8498  -11.0588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  9 12  1  0
  8 18  1  0
 18 19  1  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 21 24  1  0
  3 25  1  0
 26 27  1  0
 26 28  2  0
 15 26  1  0
 27 29  1  0
 29 30  1  0
 24 31  1  0
 24 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4446036

    ---

Associated Targets(Human)

TRPV4 Tchem Transient receptor potential cation channel subfamily V member 4 (774 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 438.50Molecular Weight (Monoisotopic): 438.2067AlogP: 3.23#Rotatable Bonds: 5
Polar Surface Area: 67.67Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.78CX LogP: 4.04CX LogD: 3.51
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.57Np Likeness Score: -1.50

References

1. Atobe M, Nagami T, Muramatsu S, Ohno T, Kitagawa M, Suzuki H, Ishiguro M, Watanabe A, Kawanishi M..  (2019)  Discovery of Novel Transient Receptor Potential Vanilloid 4 (TRPV4) Agonists as Regulators of Chondrogenic Differentiation: Identification of Quinazolin-4(3 H)-ones and in Vivo Studies on a Surgically Induced Rat Model of Osteoarthritis.,  62  (3): [PMID:30629441] [10.1021/acs.jmedchem.8b01615]

Source