Ratjadone C

ID: ALA4446133

PubChem CID: 97947825

Max Phase: Preclinical

Molecular Formula: C28H40O5

Molecular Weight: 456.62

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C/C=C/[C@@H]1O[C@H]([C@H](O)/C=C/C=C/C[C@@H](C)/C=C(\C=C\[C@H]2CC=CC(=O)O2)CC)C[C@@H](O)[C@@H]1C

Standard InChI:  InChI=1S/C28H40O5/c1-5-11-26-21(4)25(30)19-27(33-26)24(29)14-9-7-8-12-20(3)18-22(6-2)16-17-23-13-10-15-28(31)32-23/h5,7-11,14-18,20-21,23-27,29-30H,6,12-13,19H2,1-4H3/b8-7+,11-5+,14-9+,17-16+,22-18-/t20-,21+,23-,24-,25-,26+,27+/m1/s1

Standard InChI Key:  QHBAIVURIOKLSG-RVNOVNSXSA-N

Molfile:  

 
     RDKit          2D

 34 35  0  0  0  0  0  0  0  0999 V2000
    7.2972  -10.9888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2972  -11.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0066  -12.2235    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7202  -11.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7202  -10.9888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0066  -10.5716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0066   -9.7497    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5823  -10.5769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5809  -12.2272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8668  -11.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1546  -12.2304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4325  -12.2272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4306  -13.0532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1464  -11.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8586  -12.2304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5768  -11.8169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2890  -12.2293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0030  -11.8200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7152  -12.2325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4334  -11.8232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7175  -13.0584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4298  -13.4710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4280  -14.2969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1438  -13.0616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8560  -13.4741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5701  -13.0605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1402  -14.7094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2799  -13.4770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9948  -13.0688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9989  -12.2464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2870  -11.8307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5667  -12.2372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7047  -13.4853    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7124  -12.6365    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  4  3  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  6
  1  8  1  1
  2  9  1  1
  9 10  2  0
 10 11  1  0
  4 12  1  0
 12 13  1  1
 12 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  1  1
 19 21  1  0
 21 22  2  0
 22 23  1  0
 22 24  1  0
 24 25  2  0
 26 25  1  1
 23 27  1  0
 26 28  1  0
 26 32  1  0
 28 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 29 33  2  0
  4 34  1  6
M  END

Associated Targets(Human)

XPO1 Tclin Exportin-1 (375 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 456.62Molecular Weight (Monoisotopic): 456.2876AlogP: 4.98#Rotatable Bonds: 10
Polar Surface Area: 75.99Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.77CX Basic pKa: CX LogP: 5.22CX LogD: 5.22
Aromatic Rings: Heavy Atoms: 33QED Weighted: 0.28Np Likeness Score: 2.97

References

1.  (2013)  Novel drug targets to overcome de novo drug-resistance in multiple myeloma, 

Source