The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-[5-benzyl-4-(4-methoxyphenyl)thiazol-2-yl]-piperazine trihydrochloride ID: ALA4446182
PubChem CID: 23655017
Max Phase: Preclinical
Molecular Formula: C21H26Cl3N3OS
Molecular Weight: 365.50
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2nc(N3CCNCC3)sc2Cc2ccccc2)cc1.Cl.Cl.Cl
Standard InChI: InChI=1S/C21H23N3OS.3ClH/c1-25-18-9-7-17(8-10-18)20-19(15-16-5-3-2-4-6-16)26-21(23-20)24-13-11-22-12-14-24;;;/h2-10,22H,11-15H2,1H3;3*1H
Standard InChI Key: DSUIAGLLCUIDBP-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 29 0 0 0 0 0 0 0 0999 V2000
14.7449 -12.7811 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.6448 -12.0028 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.3059 -11.5225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0524 -11.8549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1379 -12.6676 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4767 -13.1479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7302 -12.8156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7283 -10.8711 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
14.8982 -11.6705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1905 -12.0791 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5832 -11.5322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9156 -10.7857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7839 -11.7021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5314 -12.4793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7320 -12.6492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1852 -12.0420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4378 -11.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2371 -11.0949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3859 -12.2119 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1334 -12.9891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5070 -10.0780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9156 -9.3703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5070 -8.6626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9156 -7.9549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7328 -7.9549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1414 -8.6626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7328 -9.3703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7101 -9.7855 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.6176 -10.3846 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
2 7 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
8 12 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
13 18 2 0
19 20 1 0
16 19 1 0
11 13 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
22 27 2 0
12 21 1 0
2 9 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 365.50Molecular Weight (Monoisotopic): 365.1562AlogP: 3.82#Rotatable Bonds: 5Polar Surface Area: 37.39Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.69CX LogP: 4.99CX LogD: 3.68Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.75Np Likeness Score: -1.14
References 1. (2014) 2,4,5-trisubstituted thiazole compounds,preparation methods,pharmaceutical compositions and medical uses thereof, 2. (2016) 2,4,5-trisubstituted thiazole compounds,preparation methods,pharmaceutical compositions and medical uses thereof,