1-[5-benzyl-4-(4-methoxyphenyl)thiazol-2-yl]-piperazine trihydrochloride

ID: ALA4446182

PubChem CID: 23655017

Max Phase: Preclinical

Molecular Formula: C21H26Cl3N3OS

Molecular Weight: 365.50

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2nc(N3CCNCC3)sc2Cc2ccccc2)cc1.Cl.Cl.Cl

Standard InChI:  InChI=1S/C21H23N3OS.3ClH/c1-25-18-9-7-17(8-10-18)20-19(15-16-5-3-2-4-6-16)26-21(23-20)24-13-11-22-12-14-24;;;/h2-10,22H,11-15H2,1H3;3*1H

Standard InChI Key:  DSUIAGLLCUIDBP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 29  0  0  0  0  0  0  0  0999 V2000
   14.7449  -12.7811    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   15.6448  -12.0028    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.3059  -11.5225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0524  -11.8549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1379  -12.6676    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.4767  -13.1479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7302  -12.8156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7283  -10.8711    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.8982  -11.6705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1905  -12.0791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5832  -11.5322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9156  -10.7857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7839  -11.7021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5314  -12.4793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7320  -12.6492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1852  -12.0420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4378  -11.2648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2371  -11.0949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3859  -12.2119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1334  -12.9891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5070  -10.0780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9156   -9.3703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5070   -8.6626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9156   -7.9549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7328   -7.9549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1414   -8.6626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7328   -9.3703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7101   -9.7855    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   10.6176  -10.3846    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  2  7  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
  8 12  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 13 18  2  0
 19 20  1  0
 16 19  1  0
 11 13  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 22 27  2  0
 12 21  1  0
  2  9  1  0
M  END

Associated Targets(Human)

PLTP Tbio Phospholipid transfer protein (94 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CETP Tchem Cholesteryl ester transfer protein (2422 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 365.50Molecular Weight (Monoisotopic): 365.1562AlogP: 3.82#Rotatable Bonds: 5
Polar Surface Area: 37.39Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.69CX LogP: 4.99CX LogD: 3.68
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.75Np Likeness Score: -1.14

References

1.  (2014)  2,4,5-trisubstituted thiazole compounds,preparation methods,pharmaceutical compositions and medical uses thereof, 
2.  (2016)  2,4,5-trisubstituted thiazole compounds,preparation methods,pharmaceutical compositions and medical uses thereof, 

Source