The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-1-(4-(3-chloro-4-fluorophenylamino)-8,9-dihydro-[1,4]oxazepino[3,2-g]quinazolin-6(7H)-yl)-4-(1H-imidazol-1-yl)but-2-en-1-one ID: ALA4446326
PubChem CID: 78323565
Max Phase: Preclinical
Molecular Formula: C24H20ClFN6O2
Molecular Weight: 478.92
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(/C=C/Cn1ccnc1)N1CCCOc2cc3ncnc(Nc4ccc(F)c(Cl)c4)c3cc21
Standard InChI: InChI=1S/C24H20ClFN6O2/c25-18-11-16(4-5-19(18)26)30-24-17-12-21-22(13-20(17)28-14-29-24)34-10-2-8-32(21)23(33)3-1-7-31-9-6-27-15-31/h1,3-6,9,11-15H,2,7-8,10H2,(H,28,29,30)/b3-1+
Standard InChI Key: GMGHMRMXKSVYKO-HNQUOIGGSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
16.2374 -23.9238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2355 -22.2707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9510 -22.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9517 -23.5067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6671 -23.9177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3821 -23.5030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3773 -22.6729 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6614 -22.2658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5226 -23.5109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8100 -21.4474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5249 -21.0355 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0960 -21.0343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3811 -21.4461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6670 -21.0330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9521 -21.4449 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6570 -21.4408 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3694 -21.0244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0814 -21.4366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7931 -21.0210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7892 -20.1951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0676 -19.7866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3588 -20.2045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0603 -18.9616 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
20.5010 -19.7779 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.0418 -22.5843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8171 -23.4024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2992 -24.0453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8093 -22.2724 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5185 -22.6838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1055 -24.1050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1995 -21.1126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6469 -21.7253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0588 -22.4401 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8659 -22.2692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9 1 1 0
1 4 2 0
3 2 2 0
2 29 1 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
9 29 2 0
28 10 1 0
10 11 2 0
10 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
8 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
21 23 1 0
20 24 1 0
25 26 1 0
26 27 1 0
25 28 1 0
30 27 1 0
28 29 1 0
30 9 1 0
15 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 15 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 478.92Molecular Weight (Monoisotopic): 478.1320AlogP: 4.73#Rotatable Bonds: 5Polar Surface Area: 85.17Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.76CX LogP: 3.50CX LogD: 3.43Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.42Np Likeness Score: -1.57
References 1. Sun M, Zhao J, Chen X, Zong Z, Han J, Du Y, Sun H, Wang F.. (2016) Synthesis and biological evaluation of novel tricyclic oxazine and oxazepine fused quinazolines. Part 2: Gefitinib analogs., 26 (19): [PMID:27524310 ] [10.1016/j.bmcl.2016.08.007 ]