(6S)-2E-2,6-dimethyl-6-hydroxyocta-2,7-dienoic acid beta-glucopyranosyl ester

ID: ALA4446334

PubChem CID: 155518504

Max Phase: Preclinical

Molecular Formula: C16H26O8

Molecular Weight: 346.38

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C[C@@](C)(O)CC/C=C(\C)C(=O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O

Standard InChI:  InChI=1S/C16H26O8/c1-4-16(3,22)7-5-6-9(2)14(21)24-15-13(20)12(19)11(18)10(8-17)23-15/h4,6,10-13,15,17-20,22H,1,5,7-8H2,2-3H3/b9-6+/t10-,11-,12+,13-,15+,16-/m1/s1

Standard InChI Key:  IVWJMPAYYVHQPT-UNFYXLBOSA-N

Molfile:  

 
     RDKit          2D

 24 24  0  0  0  0  0  0  0  0999 V2000
   19.1922   -4.5991    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.1922   -6.2384    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7718   -7.0582    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.3555   -6.2385    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7717   -4.5991    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.4861   -5.0069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4861   -5.8265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7717   -6.2385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0657   -5.8266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0657   -5.0070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3555   -4.5992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6488   -5.0095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.1922   -3.7819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8998   -3.3732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4844   -3.3734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.6076   -3.7818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8998   -2.5560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3152   -3.3731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0230   -3.7816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7307   -3.3730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4384   -3.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7306   -2.5558    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.0188   -2.9634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4385   -4.5987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 10  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  1
  6  1  1  1
  7  2  1  6
  8  3  1  1
  9  4  1  6
 11 12  1  0
  1 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  2  0
 14 17  1  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 20 23  1  1
 21 24  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4446334

    ---

Associated Targets(non-human)

Chorioallantoic membrane (375 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Danio rerio (3092 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 346.38Molecular Weight (Monoisotopic): 346.1628AlogP: -1.01#Rotatable Bonds: 7
Polar Surface Area: 136.68Molecular Species: NEUTRALHBA: 8HBD: 5
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 12.20CX Basic pKa: CX LogP: -0.20CX LogD: -0.20
Aromatic Rings: Heavy Atoms: 24QED Weighted: 0.22Np Likeness Score: 2.93

References

1. Beladjila KA, Berrehal D, Kabouche Z, Germanò MP, D'Angelo V, De Tommasi N, D'Andrea F, Braca A, De Leo M..  (2019)  Antiangiogenic Activity of Compounds Isolated from Anarrhinum pedatum.,  82  (3): [PMID:30835462] [10.1021/acs.jnatprod.8b00893]

Source