2-nitro-N'-((5-(pyridin-2-ylthio)furan-2-yl)methylene)benzohydrazide

ID: ALA4446652

PubChem CID: 51660057

Max Phase: Preclinical

Molecular Formula: C17H12N4O4S

Molecular Weight: 368.37

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(N/N=C/c1ccc(Sc2ccccn2)o1)c1ccccc1[N+](=O)[O-]

Standard InChI:  InChI=1S/C17H12N4O4S/c22-17(13-5-1-2-6-14(13)21(23)24)20-19-11-12-8-9-16(25-12)26-15-7-3-4-10-18-15/h1-11H,(H,20,22)/b19-11+

Standard InChI Key:  SGLOCNQLYFWWTN-YBFXNURJSA-N

Molfile:  

 
     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
   14.0204  -18.5747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8376  -18.5747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0919  -17.7980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4290  -17.3159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7702  -17.7980    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.4277  -16.4987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7194  -16.0912    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.7182  -15.2740    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5392  -19.2352    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.8706  -19.9822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3876  -20.6426    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.7184  -21.3890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5318  -21.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0134  -20.8105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6800  -20.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4252  -14.8643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4240  -14.0471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1336  -15.2718    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1312  -13.6398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1303  -12.8234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4214  -12.4150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7120  -12.8291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7164  -13.6442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8389  -14.0484    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.8389  -14.8656    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5466  -13.6398    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  1  0
  4  6  1  0
  6  7  2  0
  7  8  1  0
  1  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  8 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 17  1  0
 19 24  1  0
 24 25  1  0
 24 26  2  0
M  CHG  2  24   1  25  -1
M  END

Associated Targets(Human)

EYA2 Tbio Eyes absent homolog 2 (5884 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 368.37Molecular Weight (Monoisotopic): 368.0579AlogP: 3.50#Rotatable Bonds: 6
Polar Surface Area: 110.63Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.88CX Basic pKa: 2.24CX LogP: 3.62CX LogD: 3.61
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.40Np Likeness Score: -2.12

References

1.  (2012)  Inhibitors of eya2, 

Source