The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-((4-Isopropylpiperazin-1-yl)methyl)-1H-1,2,3-triazol-1-yl)-N-(7-(4-(pyridin-3-yl)-1H-1,2,3-triazol-1-yl)heptyl)benzamide ID: ALA4446772
PubChem CID: 155518745
Max Phase: Preclinical
Molecular Formula: C31H42N10O
Molecular Weight: 570.75
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)N1CCN(Cc2cn(-c3ccccc3C(=O)NCCCCCCCn3cc(-c4cccnc4)nn3)nn2)CC1
Standard InChI: InChI=1S/C31H42N10O/c1-25(2)39-19-17-38(18-20-39)22-27-23-41(37-34-27)30-13-7-6-12-28(30)31(42)33-15-8-4-3-5-9-16-40-24-29(35-36-40)26-11-10-14-32-21-26/h6-7,10-14,21,23-25H,3-5,8-9,15-20,22H2,1-2H3,(H,33,42)
Standard InChI Key: MONXGYOZOQWUGM-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
2.9827 -25.1328 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8065 -25.1339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2196 -24.4258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8060 -23.7119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9790 -23.7147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5738 -24.4276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0483 -24.4229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5310 -25.0875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3164 -24.8338 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3165 -24.0082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5313 -23.7543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0275 -23.5922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7463 -23.9970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4584 -23.5803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1774 -23.9851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8894 -23.5685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6083 -23.9733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3162 -23.5566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0351 -23.9614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7471 -23.5406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4660 -23.9495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7403 -22.7151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4699 -24.7757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1880 -25.1803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9010 -24.7636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8915 -23.9339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1729 -23.5288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1615 -22.7064 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8172 -22.2164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5493 -21.4376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7268 -21.4489 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4850 -22.2349 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2622 -21.0160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9812 -21.4248 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9848 -22.2489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6997 -22.6534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4141 -22.2401 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4090 -21.4136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6895 -21.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1316 -22.6474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1355 -23.4729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8451 -22.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 7 2 0
3 7 1 0
10 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 21 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 28 1 0
30 33 1 0
33 34 1 0
34 35 1 0
34 39 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
37 40 1 0
40 41 1 0
40 42 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 570.75Molecular Weight (Monoisotopic): 570.3543AlogP: 3.83#Rotatable Bonds: 14Polar Surface Area: 109.89Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 7.93CX LogP: 3.97CX LogD: 3.33Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.23Np Likeness Score: -1.85
References 1. Travelli C, Aprile S, Mattoteia D, Colombo G, Clemente N, Scanziani E, Terrazzino S, Alisi MA, Polenzani L, Grosa G, Genazzani AA, Tron GC, Galli U.. (2019) Identification of potent triazolylpyridine nicotinamide phosphoribosyltransferase (NAMPT) inhibitors bearing a 1,2,3-triazole tail group., 181 [PMID:31400709 ] [10.1016/j.ejmech.2019.111576 ]