The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(2-(4-(2,4-difluorophenoxy)piperidin-1-yl)-3-(isopropylamino)-7,8-dihydropyrido[3,4-b]pyrazin-6(5H)-yl)-2-d3-ethan-1-one ID: ALA4447295
PubChem CID: 118180381
Max Phase: Preclinical
Molecular Formula: C23H29F2N5O2
Molecular Weight: 445.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: [2H]C([2H])([2H])C(=O)N1CCc2nc(N3CCC(Oc4ccc(F)cc4F)CC3)c(NC(C)C)nc2C1
Standard InChI: InChI=1S/C23H29F2N5O2/c1-14(2)26-22-23(28-19-8-11-30(15(3)31)13-20(19)27-22)29-9-6-17(7-10-29)32-21-5-4-16(24)12-18(21)25/h4-5,12,14,17H,6-11,13H2,1-3H3,(H,26,27)/i3D3
Standard InChI Key: FSUXDPIOBQLEKO-HPRDVNIFSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
12.3033 -4.9114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9391 -2.0595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8204 -2.4763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8193 -3.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5273 -3.7048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2370 -3.2954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2341 -2.4727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5255 -2.0674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6495 -2.4674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6500 -3.2863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3552 -3.6921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0638 -3.2844 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0627 -2.4662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3530 -2.0559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7689 -3.6897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7676 -4.5080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4745 -4.9165 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4731 -3.2816 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1805 -3.6865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1817 -4.5068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8889 -4.9137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5994 -4.5048 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5981 -3.6844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8865 -3.2730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0595 -4.9159 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1112 -3.7039 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.5231 -1.2503 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.0148 -4.5046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3014 -5.7286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0586 -5.7331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3505 -6.1409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7659 -6.1424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7207 -4.9162 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.0182 -3.6875 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.7189 -4.0901 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
7 2 1 0
2 9 1 0
9 10 1 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
15 16 2 0
16 17 1 0
17 20 2 0
19 18 2 0
18 15 1 0
12 15 1 0
19 20 1 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
16 25 1 0
4 26 1 0
8 27 1 0
22 1 1 0
1 28 1 0
1 29 2 0
25 30 1 0
30 31 1 0
30 32 1 0
28 33 1 0
28 34 1 0
28 35 1 0
M ISO 3 33 2 34 2 35 2
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 445.51Molecular Weight (Monoisotopic): 445.2289AlogP: 3.53#Rotatable Bonds: 5Polar Surface Area: 70.59Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.43CX LogP: 2.34CX LogD: 2.34Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.76Np Likeness Score: -1.26
References 1. (2018) Tetrahydropyridopyrazines modulators of gpr6, 2. (2016) Tetrahydropyridopyrazines modulators of gpr6,