1-(2-(4-(2,4-difluorophenoxy)piperidin-1-yl)-3-(isopropylamino)-7,8-dihydropyrido[3,4-b]pyrazin-6(5H)-yl)-2-d3-ethan-1-one

ID: ALA4447295

PubChem CID: 118180381

Max Phase: Preclinical

Molecular Formula: C23H29F2N5O2

Molecular Weight: 445.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  [2H]C([2H])([2H])C(=O)N1CCc2nc(N3CCC(Oc4ccc(F)cc4F)CC3)c(NC(C)C)nc2C1

Standard InChI:  InChI=1S/C23H29F2N5O2/c1-14(2)26-22-23(28-19-8-11-30(15(3)31)13-20(19)27-22)29-9-6-17(7-10-29)32-21-5-4-16(24)12-18(21)25/h4-5,12,14,17H,6-11,13H2,1-3H3,(H,26,27)/i3D3

Standard InChI Key:  FSUXDPIOBQLEKO-HPRDVNIFSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   12.3033   -4.9114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9391   -2.0595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8204   -2.4763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8193   -3.2958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5273   -3.7048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2370   -3.2954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2341   -2.4727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5255   -2.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6495   -2.4674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6500   -3.2863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3552   -3.6921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0638   -3.2844    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0627   -2.4662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3530   -2.0559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7689   -3.6897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7676   -4.5080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4745   -4.9165    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4731   -3.2816    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1805   -3.6865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1817   -4.5068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8889   -4.9137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5994   -4.5048    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5981   -3.6844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8865   -3.2730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0595   -4.9159    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1112   -3.7039    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.5231   -1.2503    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.0148   -4.5046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3014   -5.7286    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0586   -5.7331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3505   -6.1409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7659   -6.1424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7207   -4.9162    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.0182   -3.6875    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.7189   -4.0901    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  7  2  1  0
  2  9  1  0
  9 10  1  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 15 16  2  0
 16 17  1  0
 17 20  2  0
 19 18  2  0
 18 15  1  0
 12 15  1  0
 19 20  1  0
 19 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 16 25  1  0
  4 26  1  0
  8 27  1  0
 22  1  1  0
  1 28  1  0
  1 29  2  0
 25 30  1  0
 30 31  1  0
 30 32  1  0
 28 33  1  0
 28 34  1  0
 28 35  1  0
M  ISO  3  33   2  34   2  35   2
M  END

Associated Targets(Human)

GPR6 Tchem G-protein coupled receptor 6 (1468 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 445.51Molecular Weight (Monoisotopic): 445.2289AlogP: 3.53#Rotatable Bonds: 5
Polar Surface Area: 70.59Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.43CX LogP: 2.34CX LogD: 2.34
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.76Np Likeness Score: -1.26

References

1.  (2018)  Tetrahydropyridopyrazines modulators of gpr6, 
2.  (2016)  Tetrahydropyridopyrazines modulators of gpr6, 

Source