3-Ethoxy-4-((4-(((1s,4s)-4-hydroxy-4-methylcyclohexyl)oxy)-7H-pyrrolo[2,3-d]pyrimidin-2-yl)amino)-N,N-dimethylbenzamide

ID: ALA4447336

PubChem CID: 155518978

Max Phase: Preclinical

Molecular Formula: C24H31N5O4

Molecular Weight: 453.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOc1cc(C(=O)N(C)C)ccc1Nc1nc(O[C@H]2CC[C@@](C)(O)CC2)c2cc[nH]c2n1

Standard InChI:  InChI=1S/C24H31N5O4/c1-5-32-19-14-15(22(30)29(3)4)6-7-18(19)26-23-27-20-17(10-13-25-20)21(28-23)33-16-8-11-24(2,31)12-9-16/h6-7,10,13-14,16,31H,5,8-9,11-12H2,1-4H3,(H2,25,26,27,28)/t16-,24+

Standard InChI Key:  UAOOTSWHWCQUJL-ONEIWYMKSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   34.4912  -12.5344    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.3084  -12.5344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8998  -11.8267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0183  -12.1299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7309  -14.9859    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.7298  -15.8055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4378  -16.2144    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.4360  -14.5771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1446  -14.9823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1494  -15.8009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9295  -16.0494    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.4068  -15.3843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9217  -14.7249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4336  -13.7599    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.7247  -13.3534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0217  -16.2135    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.3144  -15.8043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3195  -14.9873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6130  -14.5782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9040  -14.9863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9060  -15.8077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6131  -16.2131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6160  -17.0303    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.9098  -17.4414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1961  -14.5781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1956  -13.7609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.4886  -14.9871    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.7806  -14.5788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4890  -15.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7248  -12.5372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3116  -13.3562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0209  -13.7671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2006  -17.0354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  3  2  1  0
  5  6  2  0
  6  7  1  0
  7 10  2  0
  9  8  2  0
  8  5  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13  9  1  0
  8 14  1  0
 15 14  1  1
  6 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 22 23  1  0
 23 24  1  0
 20 25  1  0
 25 26  2  0
 25 27  1  0
 27 28  1  0
 27 29  1  0
 15 30  1  0
 15 32  1  0
 30  4  1  0
  4  2  1  0
  2 31  1  0
 31 32  1  0
 24 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4447336

    ---

Associated Targets(Human)

CAL-51 (262 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 453.54Molecular Weight (Monoisotopic): 453.2376AlogP: 3.87#Rotatable Bonds: 7
Polar Surface Area: 112.60Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 11.83CX Basic pKa: 4.66CX LogP: 3.26CX LogD: 3.26
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.50Np Likeness Score: -0.60

References

1. Riggs JR, Elsner J, Cashion D, Robinson D, Tehrani L, Nagy M, Fultz KE, Krishna Narla R, Peng X, Tran T, Kulkarni A, Bahmanyar S, Condroski K, Pagarigan B, Fenalti G, LeBrun L, Leftheris K, Zhu D, Boylan JF..  (2019)  Design and Optimization Leading to an Orally Active TTK Protein Kinase Inhibitor with Robust Single Agent Efficacy.,  62  (9): [PMID:30998356] [10.1021/acs.jmedchem.8b01869]

Source