The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N'-(dodecane-1,12-diyl)bis(N',3-dimethoxybenzimidamide) ID: ALA4447383
PubChem CID: 155519215
Max Phase: Preclinical
Molecular Formula: C30H46N4O4
Molecular Weight: 526.72
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CO/N=C(\NCCCCCCCCCCCCN/C(=N\OC)c1cccc(OC)c1)c1cccc(OC)c1
Standard InChI: InChI=1S/C30H46N4O4/c1-35-27-19-15-17-25(23-27)29(33-37-3)31-21-13-11-9-7-5-6-8-10-12-14-22-32-30(34-38-4)26-18-16-20-28(24-26)36-2/h15-20,23-24H,5-14,21-22H2,1-4H3,(H,31,33)(H,32,34)
Standard InChI Key: DRFVVBOIJKTZAS-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 39 0 0 0 0 0 0 0 0999 V2000
1.2318 -14.7040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2307 -15.5313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9455 -15.9442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6620 -15.5308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6591 -14.7004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9438 -14.2912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3720 -14.2851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0880 -14.6949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3689 -13.4601 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0818 -13.0449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8009 -14.2798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5170 -14.6896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2299 -14.2743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9459 -14.6842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6588 -14.2690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3748 -14.6788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0877 -14.2636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8037 -14.6734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5166 -14.2582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2326 -14.6681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9455 -14.2528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6615 -14.6626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3744 -14.2475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0904 -14.6573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8033 -14.2420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0935 -15.4823 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3806 -15.8974 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5187 -14.6539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2311 -14.2395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2285 -13.4136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5075 -13.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7980 -13.4209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9470 -14.6496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6600 -14.2348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5173 -14.2916 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1971 -14.7043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0787 -12.2200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6646 -15.4876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
7 9 2 0
9 10 1 0
8 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
26 27 1 0
25 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 25 1 0
29 33 1 0
33 34 1 0
1 35 1 0
35 36 1 0
10 37 1 0
27 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 526.72Molecular Weight (Monoisotopic): 526.3519AlogP: 6.10#Rotatable Bonds: 19Polar Surface Area: 85.70Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 6.37CX LogP: 6.74CX LogD: 6.70Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.10Np Likeness Score: -0.29
References 1. Berger O, Ortial S, Wein S, Denoyelle S, Bressolle F, Durand T, Escale R, Vial HJ, Vo-Hoang Y.. (2019) Evaluation of amidoxime derivatives as prodrug candidates of potent bis-cationic antimalarials., 29 (16): [PMID:31255483 ] [10.1016/j.bmcl.2019.06.045 ]