N,N'-(dodecane-1,12-diyl)bis(N',3-dimethoxybenzimidamide)

ID: ALA4447383

PubChem CID: 155519215

Max Phase: Preclinical

Molecular Formula: C30H46N4O4

Molecular Weight: 526.72

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CO/N=C(\NCCCCCCCCCCCCN/C(=N\OC)c1cccc(OC)c1)c1cccc(OC)c1

Standard InChI:  InChI=1S/C30H46N4O4/c1-35-27-19-15-17-25(23-27)29(33-37-3)31-21-13-11-9-7-5-6-8-10-12-14-22-32-30(34-38-4)26-18-16-20-28(24-26)36-2/h15-20,23-24H,5-14,21-22H2,1-4H3,(H,31,33)(H,32,34)

Standard InChI Key:  DRFVVBOIJKTZAS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 39  0  0  0  0  0  0  0  0999 V2000
    1.2318  -14.7040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2307  -15.5313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9455  -15.9442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6620  -15.5308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6591  -14.7004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9438  -14.2912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3720  -14.2851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0880  -14.6949    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3689  -13.4601    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0818  -13.0449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8009  -14.2798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5170  -14.6896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2299  -14.2743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9459  -14.6842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6588  -14.2690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3748  -14.6788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0877  -14.2636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8037  -14.6734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5166  -14.2582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2326  -14.6681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9455  -14.2528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6615  -14.6626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3744  -14.2475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0904  -14.6573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8033  -14.2420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0935  -15.4823    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3806  -15.8974    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5187  -14.6539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2311  -14.2395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2285  -13.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5075  -13.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7980  -13.4209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9470  -14.6496    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6600  -14.2348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5173  -14.2916    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1971  -14.7043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0787  -12.2200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6646  -15.4876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  9 10  1  0
  8 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  2  0
 26 27  1  0
 25 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 25  1  0
 29 33  1  0
 33 34  1  0
  1 35  1  0
 35 36  1  0
 10 37  1  0
 27 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4447383

    ---

Associated Targets(non-human)

Plasmodium vinckei petteri (380 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 526.72Molecular Weight (Monoisotopic): 526.3519AlogP: 6.10#Rotatable Bonds: 19
Polar Surface Area: 85.70Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 6.37CX LogP: 6.74CX LogD: 6.70
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.10Np Likeness Score: -0.29

References

1. Berger O, Ortial S, Wein S, Denoyelle S, Bressolle F, Durand T, Escale R, Vial HJ, Vo-Hoang Y..  (2019)  Evaluation of amidoxime derivatives as prodrug candidates of potent bis-cationic antimalarials.,  29  (16): [PMID:31255483] [10.1016/j.bmcl.2019.06.045]

Source