2-[(3S,4R)-1-[(2-Chloro-6-methylphenyl)methyl]-3-{[(1-cyclopent-1-en-1-ylmethyl)piperidin-4-yl]carbamoyl}-4-methylpyrrolidin-3-yl]acetic acid

ID: ALA4447653

PubChem CID: 71293715

Max Phase: Preclinical

Molecular Formula: C27H38ClN3O3

Molecular Weight: 488.07

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cccc(Cl)c1CN1C[C@H](C)[C@](CC(=O)O)(C(=O)NC2CCN(CC3=CCCC3)CC2)C1

Standard InChI:  InChI=1S/C27H38ClN3O3/c1-19-6-5-9-24(28)23(19)17-31-15-20(2)27(18-31,14-25(32)33)26(34)29-22-10-12-30(13-11-22)16-21-7-3-4-8-21/h5-7,9,20,22H,3-4,8,10-18H2,1-2H3,(H,29,34)(H,32,33)/t20-,27+/m0/s1

Standard InChI Key:  QQFJWVDGLRZHFD-CCLHPLFOSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   20.9013   -8.6338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0539   -8.7439    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.5537   -8.0957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7355   -8.2018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9022   -8.1912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4020   -7.5430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6463   -8.9673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3397   -9.5012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9841   -8.9718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3252  -10.3054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6072  -10.7254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6295  -11.5842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3539  -11.9663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9115  -12.0043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1749  -11.5948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1563  -10.7652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8706  -10.3159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8812   -9.4825    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   18.4840   -7.4225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0331   -6.8149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8318   -6.9965    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7817   -6.0356    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.8680   -7.3120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2194   -7.8794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0376   -7.7732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5377   -8.4214    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.3851   -8.3114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8891   -8.9888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7076   -8.9796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9693   -9.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3126  -10.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6449   -9.7701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2234   -9.2050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4053   -9.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  6
  4  5  1  0
  5  6  1  6
  5  7  1  0
  8  7  1  0
  8  9  1  0
  9  4  1  0
  8 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 14 12  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 11 17  1  0
 17 18  1  0
  4 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
  3 23  2  0
 24  1  1  0
 25 24  1  0
 26 25  1  0
 26 27  1  0
 27 28  1  0
 29 28  1  0
 30 29  1  0
 31 30  1  0
 32 31  1  0
 32 28  2  0
 26 33  1  0
 34 33  1  0
  1 34  1  0
M  END

Associated Targets(Human)

CX3CR1 Tchem C-X3-C chemokine receptor 1 (1686 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 488.07Molecular Weight (Monoisotopic): 487.2602AlogP: 4.25#Rotatable Bonds: 8
Polar Surface Area: 72.88Molecular Species: ZWITTERIONHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 4.00CX Basic pKa: 9.42CX LogP: 0.68CX LogD: -0.38
Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.54Np Likeness Score: -0.50

References

1.  (2014)  Pyrrolidine-3-ylacetic acid derivative, 

Source