The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-2-[[(2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]-N-[(1S)-1-benzyl-2-[[(1S)-1-formyl-3-methyl-butyl]amino]-2-oxo-ethyl]-4-methyl-pentanamide ID: ALA4447701
PubChem CID: 155519835
Max Phase: Preclinical
Molecular Formula: C32H44N4O6
Molecular Weight: 580.73
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C=O)CC(C)C
Standard InChI: InChI=1S/C32H44N4O6/c1-20(2)15-25(19-37)34-30(40)29(17-23-9-7-6-8-10-23)36-31(41)27(16-21(3)4)35-32(42)28(33-22(5)38)18-24-11-13-26(39)14-12-24/h6-14,19-21,25,27-29,39H,15-18H2,1-5H3,(H,33,38)(H,34,40)(H,35,42)(H,36,41)/t25-,27-,28-,29-/m0/s1
Standard InChI Key: AEAFOESGPVOKBP-AMEOFWRWSA-N
Molfile:
RDKit 2D
42 43 0 0 0 0 0 0 0 0999 V2000
13.6405 -5.6337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3523 -5.2251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0642 -5.6337 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3523 -4.4038 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7760 -5.2251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4837 -5.6337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1955 -5.2251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4837 -6.4550 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9074 -5.6337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6192 -5.2251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3310 -5.6337 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6192 -4.4038 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0429 -5.2251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7547 -5.6337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4624 -5.2251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.7547 -6.4550 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1743 -5.6337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8861 -5.2251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5979 -5.6337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1743 -6.4550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9074 -6.4550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6192 -6.8677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6192 -7.6890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3310 -6.4550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8861 -6.8677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8861 -7.6890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5979 -6.4550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7760 -4.4038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4837 -3.9910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1953 -4.4063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9067 -3.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9071 -3.1721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1903 -2.7636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4819 -3.1739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6184 -2.7625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0429 -4.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7506 -3.9993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4584 -4.4098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1656 -4.0019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1661 -3.1839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4534 -2.7754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7491 -3.1857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
3 5 1 0
5 6 1 0
6 7 1 0
6 8 2 0
7 9 1 0
9 10 1 0
10 11 1 0
10 12 2 0
11 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
17 18 1 0
18 19 2 0
17 20 1 6
9 21 1 6
21 22 1 0
22 23 1 0
22 24 1 0
20 25 1 0
25 26 1 0
25 27 1 0
5 28 1 1
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
32 35 1 0
13 36 1 1
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 37 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 580.73Molecular Weight (Monoisotopic): 580.3261AlogP: 2.43#Rotatable Bonds: 16Polar Surface Area: 153.70Molecular Species: NEUTRALHBA: 6HBD: 5#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.50CX Basic pKa: ┄CX LogP: 2.99CX LogD: 2.99Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.19Np Likeness Score: 0.35
References 1. Patel KD, De Zoysa GH, Kanamala M, Patel K, Pilkington LI, Barker D, Reynisson J, Wu Z, Sarojini V.. (2020) Novel Cell-Penetrating Peptide Conjugated Proteasome Inhibitors: Anticancer and Antifungal Investigations., 63 (1): [PMID:31801019 ] [10.1021/acs.jmedchem.9b01694 ]