The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-((R)-3-(1H-benzo[d]imidazol-2-yl)morpholino)-3-(2-(5-methylbiphenyl-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl)propan-1-one ID: ALA4447716
PubChem CID: 123132902
Max Phase: Preclinical
Molecular Formula: C34H31N5O2
Molecular Weight: 541.66
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(-c2[nH]c3ncccc3c2CCC(=O)N2CCOC[C@H]2c2nc3ccccc3[nH]2)c(-c2ccccc2)c1
Standard InChI: InChI=1S/C34H31N5O2/c1-22-13-14-25(27(20-22)23-8-3-2-4-9-23)32-24(26-10-7-17-35-33(26)38-32)15-16-31(40)39-18-19-41-21-30(39)34-36-28-11-5-6-12-29(28)37-34/h2-14,17,20,30H,15-16,18-19,21H2,1H3,(H,35,38)(H,36,37)/t30-/m0/s1
Standard InChI Key: NWWYHKMOCXEJLJ-PMERELPUSA-N
Molfile:
RDKit 2D
41 47 0 0 0 0 0 0 0 0999 V2000
14.9034 -23.1634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7188 -23.1646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1257 -22.4601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4966 -22.4619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8998 -21.7568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7162 -21.7502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9623 -20.9717 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2978 -20.4970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6413 -20.9823 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2922 -19.6843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9984 -19.2712 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9937 -18.4575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2845 -18.0509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5783 -18.4640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5814 -19.2838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7084 -19.6757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7131 -20.4929 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4138 -19.2630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1238 -19.6676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8292 -19.2549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5774 -19.5813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1207 -18.9708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9098 -18.4400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7056 -18.2666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9519 -17.4950 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4058 -16.8914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6100 -17.0649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3603 -17.8419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5713 -20.3968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8597 -20.7974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8533 -21.6121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5570 -22.0260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2687 -21.6191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2716 -20.8057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9762 -20.4017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6825 -20.8150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3914 -20.4102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3954 -19.5921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6844 -19.1806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9784 -19.5879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5520 -22.8431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
10 8 1 6
11 16 1 0
16 17 2 0
16 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 24 1 0
23 20 1 0
23 24 1 0
23 28 2 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
21 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
34 35 1 0
32 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 541.66Molecular Weight (Monoisotopic): 541.2478AlogP: 6.61#Rotatable Bonds: 6Polar Surface Area: 86.90Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.34CX Basic pKa: 4.93CX LogP: 5.75CX LogD: 5.75Aromatic Rings: 6Heavy Atoms: 41QED Weighted: 0.25Np Likeness Score: -0.88
References 1. Schauer NJ, Magin RS, Liu X, Doherty LM, Buhrlage SJ.. (2020) Advances in Discovering Deubiquitinating Enzyme (DUB) Inhibitors., 63 (6): [PMID:31682427 ] [10.1021/acs.jmedchem.9b01138 ] 2. Perez, Christian C and 8 more authors. 2017-02-23 Discovery of an Inhibitor of the Proteasome Subunit Rpn11. [PMID:28191850 ]