The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Baraphenazine F ID: ALA4448261
PubChem CID: 155519327
Max Phase: Preclinical
Molecular Formula: C25H16N4O6
Molecular Weight: 468.43
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1ccc(O)c2nc3c4c(ccc3nc12)[C@@H]1Cc2nc3cccc(O)c3nc2[C@H](O4)[C@H]1O
Standard InChI: InChI=1S/C25H16N4O6/c30-15-3-1-2-12-18(15)28-20-14(26-12)8-11-9-4-6-13-19(23(9)35-24(20)22(11)32)29-21-16(31)7-5-10(25(33)34)17(21)27-13/h1-7,11,22,24,30-32H,8H2,(H,33,34)/t11-,22-,24-/m0/s1
Standard InChI Key: GTOOBNVUAQLCTL-UNJFYZGVSA-N
Molfile:
RDKit 2D
37 43 0 0 0 0 0 0 0 0999 V2000
13.4208 -19.1771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4191 -20.0099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1355 -20.4230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1369 -18.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8543 -19.1758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8513 -20.0037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5726 -20.4180 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5641 -18.7608 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1332 -17.9350 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2821 -19.1695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2848 -19.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0029 -20.4100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9976 -18.7496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7184 -19.1648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4292 -20.4001 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
16.9917 -17.9209 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
17.0001 -19.5710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7084 -18.3293 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7001 -19.9751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4196 -18.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4168 -19.5668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1288 -19.9798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8440 -19.5690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1302 -18.3315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8402 -18.7434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5499 -18.3347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1293 -17.5151 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.8360 -17.1038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5464 -17.5151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2557 -17.1056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2558 -16.2849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5406 -15.8755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8343 -16.2874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1185 -15.8772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.9702 -17.5181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9702 -18.3431 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6847 -17.1056 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 11 2 0
10 8 2 0
8 5 1 0
4 9 1 0
10 11 1 0
10 13 1 0
11 12 1 0
12 19 1 0
14 13 1 0
14 19 1 0
19 15 1 1
13 16 1 1
14 17 1 1
13 18 1 0
18 20 1 0
21 19 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 25 1 0
24 20 1 0
24 25 1 0
25 26 2 0
26 29 1 0
28 27 1 0
27 24 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 28 2 0
33 34 1 0
30 35 1 0
35 36 2 0
35 37 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.43Molecular Weight (Monoisotopic): 468.1070AlogP: 2.97#Rotatable Bonds: 1Polar Surface Area: 158.78Molecular Species: ACIDHBA: 9HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.71CX Basic pKa: 2.14CX LogP: 2.42CX LogD: -0.93Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.27Np Likeness Score: 0.98
References 1. Wang X, Abbas M, Zhang Y, Elshahawi SI, Ponomareva LV, Cui Z, Van Lanen SG, Sajid I, Voss SR, Shaaban KA, Thorson JS.. (2019) Baraphenazines A-G, Divergent Fused Phenazine-Based Metabolites from a Himalayan Streptomyces., 82 (6): [PMID:31117525 ] [10.1021/acs.jnatprod.9b00289 ]