The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(4-(4-hydroxyphenylthio)phenoxy)tetrahydro-2H-pyran-3,4,5-triol ID: ALA4448522
PubChem CID: 155519933
Max Phase: Preclinical
Molecular Formula: C18H20O7S
Molecular Weight: 380.42
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: OC[C@H]1O[C@@H](Oc2ccc(Sc3ccc(O)cc3)cc2)[C@H](O)[C@@H](O)[C@@H]1O
Standard InChI: InChI=1S/C18H20O7S/c19-9-14-15(21)16(22)17(23)18(25-14)24-11-3-7-13(8-4-11)26-12-5-1-10(20)2-6-12/h1-8,14-23H,9H2/t14-,15-,16+,17-,18-/m1/s1
Standard InChI Key: LNJFCCYCAUOESY-UYTYNIKBSA-N
Molfile:
RDKit 2D
26 28 0 0 0 0 0 0 0 0999 V2000
6.7447 -29.1332 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0389 -28.7038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3155 -29.1004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2979 -29.9264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6097 -28.6710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8863 -29.0675 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6273 -27.8450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9236 -27.4192 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3507 -27.4485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0565 -27.8778 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3704 -26.6262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0937 -26.2296 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4605 -27.8941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4594 -28.7214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1742 -29.1342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8906 -28.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8878 -27.8904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1724 -27.4813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6006 -27.4752 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.3166 -27.8850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3163 -28.7076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0314 -29.1173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7453 -28.7021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7396 -27.8729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0239 -27.4670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4619 -29.1109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
2 3 1 0
3 4 1 6
3 5 1 0
5 6 1 1
5 7 1 0
7 8 1 6
7 9 1 0
9 10 1 0
9 11 1 1
11 12 1 0
2 10 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
14 1 1 0
17 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
23 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 380.42Molecular Weight (Monoisotopic): 380.0930AlogP: 0.72#Rotatable Bonds: 5Polar Surface Area: 119.61Molecular Species: NEUTRALHBA: 8HBD: 5#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.27CX Basic pKa: ┄CX LogP: 1.29CX LogD: 1.28Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.51Np Likeness Score: 1.15
References 1. Chen SY, Geng CA, Ma YB, Huang XY, Yang XT, Su LH, He XF, Li TZ, Deng ZT, Gao Z, Zhang XM, Chen JJ.. (2019) Polybenzyls from Gastrodia elata, their agonistic effects on melatonin receptors and structure-activity relationships., 27 (15): [PMID:31204226 ] [10.1016/j.bmc.2019.06.008 ]