7-(4-(4-((3-(4-cyano-3-(trifluoromethyl)phenyl)-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)methyl)phenyl)-1H-1,2,3-triazol-1-yl)-N-hydroxyheptanamide

ID: ALA4448523

PubChem CID: 56961886

Max Phase: Preclinical

Molecular Formula: C29H30F3N7O4

Molecular Weight: 597.60

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  CC1(C)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=O)N1Cc1ccc(-c2cn(CCCCCCC(=O)NO)nn2)cc1

Standard InChI:  InChI=1S/C29H30F3N7O4/c1-28(2)26(41)39(22-13-12-21(16-33)23(15-22)29(30,31)32)27(42)38(28)17-19-8-10-20(11-9-19)24-18-37(36-34-24)14-6-4-3-5-7-25(40)35-43/h8-13,15,18,43H,3-7,14,17H2,1-2H3,(H,35,40)

Standard InChI Key:  BJZVXZMNIAKNHY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 43 46  0  0  0  0  0  0  0  0999 V2000
   15.9710   -5.1260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9698   -5.9455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6779   -6.3545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3875   -5.9450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3847   -5.1224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6761   -4.7171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4270   -2.3852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2012   -2.6550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0477   -1.8496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9726   -3.4421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6494   -3.9001    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.2953   -3.3993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0164   -2.6285    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2039   -3.7195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0802   -3.6268    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4749   -1.9520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2899   -2.0107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6423   -2.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4566   -2.8075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9158   -2.1305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5550   -1.3926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7418   -1.3371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7310   -2.1882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1579   -2.8797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9510   -2.6827    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.0087   -1.8674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.2512   -1.5608    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.5766   -3.2085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3447   -2.9296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9703   -3.4554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7384   -3.1765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3640   -3.7023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1321   -3.4235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7577   -3.9493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5258   -3.6704    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.6151   -4.7539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.1514   -4.1962    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6806   -7.1677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6804   -7.9848    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.0977   -6.3509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7422   -6.7217    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.2353   -7.1938    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.8955   -6.0462    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  8  7  1  0
  9  8  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13  8  1  0
  8 10  1  0
 10 14  2  0
 12 15  2  0
 11  6  1  0
 13 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 20 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 23  1  0
 25 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  2  0
 35 37  1  0
 38 39  3  0
  3 38  1  0
 40 41  1  0
 40 42  1  0
 40 43  1  0
  4 40  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4448523

   7-[4-[4-[[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]methyl]phenyl]triazol-1-yl]-N-hydroxyheptanamide

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 597.60

Molecular Weight (Monoisotopic): 597.2311

AlogP: 5.04

#Rotatable Bonds: 11

Polar Surface Area: 144.45

Molecular Species: NEUTRAL

HBA: 8

HBD: 2

#RO5 Violations: 2

HBA (Lipinski): 11

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 3

CX Acidic pKa: 8.91

CX Basic pKa: ┄

CX LogP: 4.72

CX LogD: 4.71

Aromatic Rings: 3

Heavy Atoms: 43

QED Weighted: 0.14

Np Likeness Score: -1.35

References

1. Sangwan R, Rajan R, Mandal PK..  (2018)  HDAC as onco target: Reviewing the synthetic approaches with SAR study of their inhibitors.,  158  [PMID:30245394] [10.1016/j.ejmech.2018.08.073]

2. Vaidya GN, Rana P, Venkatesh A, Chatterjee DR, Contractor D, Satpute DP, Nagpure M, Jain A, Kumar D..  (2021)  Paradigm shift of "classical" HDAC inhibitors to "hybrid" HDAC inhibitors in therapeutic interventions.,  209  [PMID:33143937] [10.1016/j.ejmech.2020.112844]

3. Bass AKA, El-Zoghbi MS, Nageeb EM, Mohamed MFA, Badr M, Abuo-Rahma GEA..  (2021)  Comprehensive review for anticancer hybridized multitargeting HDAC inhibitors.,  209  [PMID:33077264] [10.1016/j.ejmech.2020.112904]

4. Roche J, Bertrand P..  (2016)  Inside HDACs with more selective HDAC inhibitors.,  121  [PMID:27318122] [10.1016/j.ejmech.2016.05.047]

Source

Source(1):

• Scientific Literature