The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4,4'-bis(1-(2-(3-methoxyphenyl)hydrazono)ethyl)biphenyl ID: ALA4448739
PubChem CID: 146304257
Max Phase: Preclinical
Molecular Formula: C30H30N4O2
Molecular Weight: 478.60
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(N/N=C(\C)c2ccc(-c3ccc(/C(C)=N/Nc4cccc(OC)c4)cc3)cc2)c1
Standard InChI: InChI=1S/C30H30N4O2/c1-21(31-33-27-7-5-9-29(19-27)35-3)23-11-15-25(16-12-23)26-17-13-24(14-18-26)22(2)32-34-28-8-6-10-30(20-28)36-4/h5-20,33-34H,1-4H3/b31-21+,32-22+
Standard InChI Key: QBIBZAQAJZXWBG-RWRHWQIFSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
22.0710 -20.6113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0699 -21.4309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7779 -21.8398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4876 -21.4304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4847 -20.6077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7761 -20.2025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1879 -20.1978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8974 -20.6054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6031 -20.1948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6004 -19.3768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8862 -18.9710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1835 -19.3839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3618 -21.8389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6544 -21.4298 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.9464 -21.8378 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2390 -21.4286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2444 -20.6105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5379 -20.2014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8289 -20.6095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8309 -21.4309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5380 -21.8363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3061 -18.9646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3019 -18.1474 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.0075 -17.7352 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.0033 -16.9180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7103 -16.5070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7065 -15.6905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9961 -15.2847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2882 -15.7013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2955 -16.5164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3612 -22.6561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0158 -19.3696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1243 -21.8414 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4154 -21.4348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4123 -15.2787 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.1219 -15.6840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
5 7 1 0
2 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
10 22 1 0
22 23 2 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
13 31 1 0
22 32 1 0
20 33 1 0
33 34 1 0
27 35 1 0
35 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 478.60Molecular Weight (Monoisotopic): 478.2369AlogP: 7.04#Rotatable Bonds: 9Polar Surface Area: 67.24Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 5.39CX LogP: 6.65CX LogD: 6.64Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.20Np Likeness Score: -0.69
References 1. Thamban Chandrika N, Dennis EK, Shrestha SK, Ngo HX, Green KD, Kwiatkowski S, Deaciuc AG, Dwoskin LP, Watt DS, Garneau-Tsodikova S.. (2019) N,N'-diaryl-bishydrazones in a biphenyl platform: Broad spectrum antifungal agents., 164 [PMID:30597328 ] [10.1016/j.ejmech.2018.12.042 ]