(2R,3S,4R,5R)-2-(Hydroxymethyl)-5-(6-(4-(phenylethynyl)-phenyl)-9H-purin-9-yl)tetrahydrofuran-3,4-diol

ID: ALA4449169

PubChem CID: 155520320

Max Phase: Preclinical

Molecular Formula: C24H20N4O4

Molecular Weight: 428.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  OC[C@H]1O[C@@H](n2cnc3c(-c4ccc(C#Cc5ccccc5)cc4)ncnc32)[C@H](O)[C@@H]1O

Standard InChI:  InChI=1S/C24H20N4O4/c29-12-18-21(30)22(31)24(32-18)28-14-27-20-19(25-13-26-23(20)28)17-10-8-16(9-11-17)7-6-15-4-2-1-3-5-15/h1-5,8-11,13-14,18,21-22,24,29-31H,12H2/t18-,21-,22-,24-/m1/s1

Standard InChI Key:  CZWGXQUZWFKCSH-QMBPOEKNSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    5.6121  -24.4209    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6226  -23.0520    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1231  -23.7308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4289  -23.3204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4156  -24.1709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1415  -24.6074    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8850  -24.1938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8983  -23.3432    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1679  -22.9021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3410  -25.2274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5322  -25.4794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5229  -26.3255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3262  -26.5950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8303  -25.9146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6763  -25.9279    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5782  -27.4039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8358  -26.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0641  -26.4616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1800  -22.0561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9218  -21.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9382  -20.8047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2113  -20.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4664  -20.7874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4575  -21.6314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2223  -19.5224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2324  -18.6805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2427  -17.8345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9815  -17.4241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9921  -16.5788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2642  -16.1441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5243  -16.5605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5173  -17.4045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  5  1  0
  4  2  1  0
  2  3  2  0
  3  1  1  0
  4  5  2  0
  4  9  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 10  1  0
 10  1  1  1
 14 15  1  6
 13 16  1  6
 12 17  1  1
 17 18  1  0
  9 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 22 25  1  0
 25 26  3  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4449169

    ---

Associated Targets(Human)

NHDF (1164 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADK Tchem Adenosine kinase (1481 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

adoK Adenosine kinase (19 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mycobacterium tuberculosis (203094 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 428.45Molecular Weight (Monoisotopic): 428.1485AlogP: 1.50#Rotatable Bonds: 3
Polar Surface Area: 113.52Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.45CX Basic pKa: 2.03CX LogP: 2.30CX LogD: 2.30
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.42Np Likeness Score: 0.36

References

1. Crespo RA, Dang Q, Zhou NE, Guthrie LM, Snavely TC, Dong W, Loesch KA, Suzuki T, You L, Wang W, O'Malley T, Parish T, Olsen DB, Sacchettini JC..  (2019)  Structure-Guided Drug Design of 6-Substituted Adenosine Analogues as Potent Inhibitors of Mycobacterium tuberculosis Adenosine Kinase.,  62  (9): [PMID:31002508] [10.1021/acs.jmedchem.9b00020]

Source