The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Chloro-N-(3-((5-(hydroxymethyl)-3-(4-phenoxyphenyl)-1H-pyrazol-1-yl)methyl)phenyl)acetamide ID: ALA4449173
PubChem CID: 141741244
Max Phase: Preclinical
Molecular Formula: C25H22ClN3O3
Molecular Weight: 447.92
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCl)Nc1cccc(Cn2nc(-c3ccc(Oc4ccccc4)cc3)cc2CO)c1
Standard InChI: InChI=1S/C25H22ClN3O3/c26-15-25(31)27-20-6-4-5-18(13-20)16-29-21(17-30)14-24(28-29)19-9-11-23(12-10-19)32-22-7-2-1-3-8-22/h1-14,30H,15-17H2,(H,27,31)
Standard InChI Key: YMPYAYRZCIRFCJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
33.9120 -15.7267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5790 -16.1990 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.2354 -15.7121 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.9729 -14.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1567 -14.9483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5849 -17.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2969 -17.4153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4440 -14.2688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2588 -14.3444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7299 -13.6776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3873 -12.9347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5691 -12.8627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1016 -13.5304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8577 -12.2665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.6716 -12.3396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0113 -13.0849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8244 -13.1584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2956 -12.4896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9479 -11.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1358 -11.6756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1376 -15.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5244 -15.4476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.3043 -18.2297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0154 -18.6281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7174 -18.2106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7038 -17.3906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9921 -16.9959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0260 -19.4452 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.3236 -19.8629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3342 -20.6800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6107 -19.4635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.6319 -21.0978 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 2 0
6 7 1 0
6 2 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
4 8 1 0
11 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
1 21 1 0
21 22 1 0
7 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 7 1 0
24 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
30 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.92Molecular Weight (Monoisotopic): 447.1350AlogP: 5.06#Rotatable Bonds: 8Polar Surface Area: 76.38Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.36CX Basic pKa: 1.86CX LogP: 4.59CX LogD: 4.59Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.37Np Likeness Score: -1.40
References 1. Ran F, Liu Y, Zhang D, Liu M, Zhao G.. (2019) Discovery of novel pyrazole derivatives as potential anticancer agents in MCL., 29 (9): [PMID:30857748 ] [10.1016/j.bmcl.2019.03.005 ]