The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6,7-Dimethoxy-2-((4'-(3-((4-methyl-1,2,5-oxadiazol-3-yl)oxy)-propoxy)biphen-4-yl)methyl)-1,2,3,4-tetrahydroisoquinoline ID: ALA4449242
PubChem CID: 155520563
Max Phase: Preclinical
Molecular Formula: C30H33N3O5
Molecular Weight: 515.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OC)CN(Cc1ccc(-c3ccc(OCCCOc4nonc4C)cc3)cc1)CC2
Standard InChI: InChI=1S/C30H33N3O5/c1-21-30(32-38-31-21)37-16-4-15-36-27-11-9-24(10-12-27)23-7-5-22(6-8-23)19-33-14-13-25-17-28(34-2)29(35-3)18-26(25)20-33/h5-12,17-18H,4,13-16,19-20H2,1-3H3
Standard InChI Key: KEIBDNCEUNQCGA-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
23.2266 -14.3173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2255 -15.1369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9335 -15.5458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9317 -13.9085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6404 -14.3137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6437 -15.1389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3561 -15.5463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0697 -15.1331 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.0663 -14.3079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3493 -13.8959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7785 -15.5397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4851 -15.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1900 -15.5390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8961 -15.1291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8943 -14.3111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1805 -13.9046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4774 -14.3168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5969 -13.8991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3065 -14.3066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0121 -13.8958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0092 -13.0777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2949 -12.6722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5923 -13.0853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7147 -12.6653 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.4246 -13.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1301 -12.6577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8400 -13.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5455 -12.6501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.2554 -13.0549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3411 -13.8668 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.1414 -14.0324 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.5462 -13.3225 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.9960 -12.7182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5174 -15.5449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.8101 -15.1357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5188 -13.9089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.8112 -14.3177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1606 -11.9178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
8 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
15 18 1 0
21 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 1 0
32 33 2 0
33 29 1 0
2 34 1 0
34 35 1 0
1 36 1 0
36 37 1 0
33 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 515.61Molecular Weight (Monoisotopic): 515.2420AlogP: 5.47#Rotatable Bonds: 11Polar Surface Area: 79.08Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 7.70CX LogP: 4.87CX LogD: 4.40Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.24Np Likeness Score: -0.91
References 1. Guglielmo S, Lazzarato L, Contino M, Perrone MG, Chegaev K, Carrieri A, Fruttero R, Colabufo NA, Gasco A.. (2016) Structure-Activity Relationship Studies on Tetrahydroisoquinoline Derivatives: [4'-(6,7-Dimethoxy-3,4-dihydro-1H-isoquinolin-2-ylmethyl)biphenyl-4-ol] (MC70) Conjugated through Flexible Alkyl Chains with Furazan Moieties Gives Rise to Potent and Selective Ligands of P-glycoprotein., 59 (14): [PMID:27336199 ] [10.1021/acs.jmedchem.6b00252 ]