The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4,4'-(di-O-glutamoyl)-curcumin ID: ALA444980
PubChem CID: 25111246
Max Phase: Preclinical
Molecular Formula: C31H34N2O12
Molecular Weight: 626.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OC(=O)[C@@H](N)CCC(=O)O)c(OC)c2)ccc1OC(=O)[C@@H](N)CCC(=O)O
Standard InChI: InChI=1S/C31H34N2O12/c1-42-26-15-18(5-11-24(26)44-30(40)22(32)9-13-28(36)37)3-7-20(34)17-21(35)8-4-19-6-12-25(27(16-19)43-2)45-31(41)23(33)10-14-29(38)39/h3-8,11-12,15-16,22-23H,9-10,13-14,17,32-33H2,1-2H3,(H,36,37)(H,38,39)/b7-3+,8-4+/t22-,23-/m0/s1
Standard InChI Key: KIWSNQUBEPTHQS-LHVYAWJFSA-N
Molfile:
RDKit 2D
45 46 0 0 0 0 0 0 0 0999 V2000
2.4522 -9.2697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4504 -10.0982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1668 -10.5113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8856 -10.0975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8813 -9.2641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1641 -8.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5948 -8.8517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3089 -9.2602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0224 -8.8436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7406 -9.2562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0177 -8.0186 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4541 -8.8396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1681 -9.2522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4494 -8.0146 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8816 -8.8356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5957 -9.2440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5964 -10.0688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3133 -10.4771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0283 -10.0605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0195 -9.2332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3059 -8.8264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7308 -8.8128 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7432 -10.4716 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7403 -8.8574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7400 -8.0324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7382 -10.5099 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7259 -7.9878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4558 -10.0536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1707 -10.4647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4536 -9.2286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1771 -11.2897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0228 -10.0965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3107 -10.5082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0238 -9.2715 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3097 -11.3332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8834 -10.0467 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4047 -10.0948 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4067 -11.7448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4084 -12.5698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3052 -12.9838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1238 -12.9808 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4644 -11.7036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4665 -12.5286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1820 -12.9393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7531 -12.9429 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
9 11 2 0
10 12 1 0
12 13 1 0
12 14 2 0
13 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
20 22 1 0
19 23 1 0
1 24 1 0
24 25 1 0
2 26 1 0
22 27 1 0
23 28 1 0
28 29 1 0
28 30 2 0
29 31 1 1
31 42 1 0
26 32 1 0
32 33 1 0
32 34 2 0
33 35 1 6
35 38 1 0
1 2 2 0
29 36 1 0
33 37 1 0
38 39 1 0
39 41 1 0
39 40 2 0
42 43 1 0
43 45 2 0
43 44 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 626.62Molecular Weight (Monoisotopic): 626.2112AlogP: 2.15#Rotatable Bonds: 18Polar Surface Area: 231.84Molecular Species: ACIDHBA: 12HBD: 4#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 3.28CX Basic pKa: 7.54CX LogP: -1.98CX LogD: -2.68Aromatic Rings: 2Heavy Atoms: 45QED Weighted: 0.08Np Likeness Score: 0.51
References 1. Dubey SK, Sharma AK, Narain U, Misra K, Pati U.. (2008) Design, synthesis and characterization of some bioactive conjugates of curcumin with glycine, glutamic acid, valine and demethylenated piperic acid and study of their antimicrobial and antiproliferative properties., 43 (9): [PMID:18201805 ] [10.1016/j.ejmech.2007.11.027 ]