N,N'-(dodecane-1,12-diyl)bis(N'-hydroxy-3-methoxybenzimidamide)

ID: ALA4449903

PubChem CID: 155521307

Max Phase: Preclinical

Molecular Formula: C28H42N4O4

Molecular Weight: 498.67

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc(/C(=N/O)NCCCCCCCCCCCCN/C(=N\O)c2cccc(OC)c2)c1

Standard InChI:  InChI=1S/C28H42N4O4/c1-35-25-17-13-15-23(21-25)27(31-33)29-19-11-9-7-5-3-4-6-8-10-12-20-30-28(32-34)24-16-14-18-26(22-24)36-2/h13-18,21-22,33-34H,3-12,19-20H2,1-2H3,(H,29,31)(H,30,32)

Standard InChI Key:  LKWWQPIRJBMYQM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 37  0  0  0  0  0  0  0  0999 V2000
    1.2318  -14.7039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2307  -15.5313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9455  -15.9442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6620  -15.5308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6591  -14.7003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9438  -14.2911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3720  -14.2851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0880  -14.6949    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3689  -13.4601    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0818  -13.0449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8009  -14.2797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5169  -14.6895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2299  -14.2743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9458  -14.6842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6588  -14.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3747  -14.6787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0877  -14.2636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8036  -14.6734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5166  -14.2581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2325  -14.6680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9455  -14.2528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6614  -14.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3744  -14.2474    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0903  -14.6572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8033  -14.2420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0935  -15.4822    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3805  -15.8973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5186  -14.6539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2311  -14.2395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2284  -13.4135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5074  -13.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7979  -13.4208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9469  -14.6495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6600  -14.2347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5173  -14.2915    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1971  -14.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  9 10  1  0
  8 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  2  0
 26 27  1  0
 25 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 25  1  0
 29 33  1  0
 33 34  1  0
  1 35  1  0
 35 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4449903

    ---

Associated Targets(non-human)

Plasmodium vinckei petteri (380 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 498.67Molecular Weight (Monoisotopic): 498.3206AlogP: 5.76#Rotatable Bonds: 17
Polar Surface Area: 107.70Molecular Species: NEUTRALHBA: 6HBD: 4
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.41CX Basic pKa: 4.89CX LogP: 5.98CX LogD: 5.94
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.07Np Likeness Score: -0.28

References

1. Berger O, Ortial S, Wein S, Denoyelle S, Bressolle F, Durand T, Escale R, Vial HJ, Vo-Hoang Y..  (2019)  Evaluation of amidoxime derivatives as prodrug candidates of potent bis-cationic antimalarials.,  29  (16): [PMID:31255483] [10.1016/j.bmcl.2019.06.045]

Source