4-{2-[(2-Ethyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-ylmethylene)hydrazono]-4-phenylthiazol-3-yl}phenol

ID: ALA4449971

PubChem CID: 155521409

Max Phase: Preclinical

Molecular Formula: C28H22N6OS2

Molecular Weight: 522.66

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCc1nn2c(/C=N/N=c3\scc(-c4ccccc4)n3-c3ccc(O)cc3)c(-c3ccccc3)nc2s1

Standard InChI:  InChI=1S/C28H22N6OS2/c1-2-25-32-34-23(26(30-27(34)37-25)20-11-7-4-8-12-20)17-29-31-28-33(21-13-15-22(35)16-14-21)24(18-36-28)19-9-5-3-6-10-19/h3-18,35H,2H2,1H3/b29-17+,31-28-

Standard InChI Key:  WDMVDBDAZOBLBA-BASWLSFOSA-N

Molfile:  

 
     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
    6.5850  -15.8453    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5667  -14.5025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0942  -15.1807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3602  -14.7477    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3693  -15.5759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1600  -15.8260    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.6412  -15.1497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1451  -14.4844    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2709  -15.1933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8454  -14.4798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0182  -14.4908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6154  -15.2148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0417  -15.9290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8675  -15.9144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3003  -13.7187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4877  -13.5595    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2214  -12.7757    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4132  -12.6152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0671  -11.8701    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2487  -11.9672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0882  -12.7755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8073  -13.1777    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.4661  -11.1512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2911  -11.1404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6924  -10.4216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2699   -9.7132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4418   -9.7281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0442  -10.4473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6703   -9.0006    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4650  -15.1406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8850  -15.8495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6912  -11.3648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9369  -10.5772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3782   -9.9727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5736  -10.1545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3308  -10.9464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8912  -11.5475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  5  2  0
  4  2  1  0
  2  3  2  0
  3  1  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  4  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  3  9  1  0
  2 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 18  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 19 23  1  0
 26 29  1  0
  7 30  1  0
 30 31  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 20 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4449971

    ---

Associated Targets(non-human)

Trypanosoma brucei gambiense (523 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 522.66Molecular Weight (Monoisotopic): 522.1297AlogP: 6.18#Rotatable Bonds: 6
Polar Surface Area: 80.07Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.43CX Basic pKa: 2.01CX LogP: 6.74CX LogD: 6.74
Aromatic Rings: 6Heavy Atoms: 37QED Weighted: 0.21Np Likeness Score: -1.49

References

1. Kryshchyshyn A, Kaminskyy D, Karpenko O, Gzella A, Grellier P, Lesyk R..  (2019)  Thiazolidinone/thiazole based hybrids - New class of antitrypanosomal agents.,  174  [PMID:31051403] [10.1016/j.ejmech.2019.04.052]

Source