The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-{2-[(2-Ethyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-ylmethylene)hydrazono]-4-phenylthiazol-3-yl}phenol ID: ALA4449971
PubChem CID: 155521409
Max Phase: Preclinical
Molecular Formula: C28H22N6OS2
Molecular Weight: 522.66
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCc1nn2c(/C=N/N=c3\scc(-c4ccccc4)n3-c3ccc(O)cc3)c(-c3ccccc3)nc2s1
Standard InChI: InChI=1S/C28H22N6OS2/c1-2-25-32-34-23(26(30-27(34)37-25)20-11-7-4-8-12-20)17-29-31-28-33(21-13-15-22(35)16-14-21)24(18-36-28)19-9-5-3-6-10-19/h3-18,35H,2H2,1H3/b29-17+,31-28-
Standard InChI Key: WDMVDBDAZOBLBA-BASWLSFOSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
6.5850 -15.8453 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5667 -14.5025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0942 -15.1807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3602 -14.7477 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3693 -15.5759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1600 -15.8260 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.6412 -15.1497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1451 -14.4844 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2709 -15.1933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8454 -14.4798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0182 -14.4908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6154 -15.2148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0417 -15.9290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8675 -15.9144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3003 -13.7187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4877 -13.5595 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2214 -12.7757 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4132 -12.6152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0671 -11.8701 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2487 -11.9672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0882 -12.7755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8073 -13.1777 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.4661 -11.1512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2911 -11.1404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6924 -10.4216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2699 -9.7132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4418 -9.7281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0442 -10.4473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6703 -9.0006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4650 -15.1406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8850 -15.8495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6912 -11.3648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9369 -10.5772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3782 -9.9727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5736 -10.1545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3308 -10.9464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8912 -11.5475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 5 2 0
4 2 1 0
2 3 2 0
3 1 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 4 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
3 9 1 0
2 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 18 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
19 23 1 0
26 29 1 0
7 30 1 0
30 31 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
20 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 522.66Molecular Weight (Monoisotopic): 522.1297AlogP: 6.18#Rotatable Bonds: 6Polar Surface Area: 80.07Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.43CX Basic pKa: 2.01CX LogP: 6.74CX LogD: 6.74Aromatic Rings: 6Heavy Atoms: 37QED Weighted: 0.21Np Likeness Score: -1.49
References 1. Kryshchyshyn A, Kaminskyy D, Karpenko O, Gzella A, Grellier P, Lesyk R.. (2019) Thiazolidinone/thiazole based hybrids - New class of antitrypanosomal agents., 174 [PMID:31051403 ] [10.1016/j.ejmech.2019.04.052 ]