2-(decylsulfonyl)ethane-1,1-diyldiphosphonic acid

ID: ALA4450470

PubChem CID: 155521172

Max Phase: Preclinical

Molecular Formula: C12H28O8P2S

Molecular Weight: 394.36

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCS(=O)(=O)CC(P(=O)(O)O)P(=O)(O)O

Standard InChI:  InChI=1S/C12H28O8P2S/c1-2-3-4-5-6-7-8-9-10-23(19,20)11-12(21(13,14)15)22(16,17)18/h12H,2-11H2,1H3,(H2,13,14,15)(H2,16,17,18)

Standard InChI Key:  IXSZNZGPRCCCFS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 22  0  0  0  0  0  0  0  0999 V2000
   35.2589  -15.3244    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.6716  -16.0343    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   36.0801  -15.3219    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.9647  -16.4402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2594  -16.0275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5493  -16.4319    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   34.2354  -15.2118    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   34.9455  -14.8074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.5301  -14.7990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.2186  -14.3997    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.8441  -16.0191    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.5445  -17.2491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.8362  -16.8350    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.3801  -16.4486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0902  -16.0442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7955  -16.4569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5056  -16.0525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2109  -16.4653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9210  -16.0609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6263  -16.4736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3364  -16.0692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0417  -16.4820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7518  -16.0776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  5  7  1  0
  7  8  2  0
  7  9  1  0
  7 10  1  0
  6 11  1  0
  6 12  2  0
  6 13  1  0
  4  2  1  0
  2 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4450470

    ---

Associated Targets(non-human)

Toxoplasma gondii (4585 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FPPS Farnesyl diphosphate synthase (70 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Trypanosoma cruzi (99888 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Farnesyl diphosphate synthase (67 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 394.36Molecular Weight (Monoisotopic): 394.0980AlogP: 2.22#Rotatable Bonds: 13
Polar Surface Area: 149.20Molecular Species: ACIDHBA: 4HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 1.19CX Basic pKa: CX LogP: 0.45CX LogD: -4.30
Aromatic Rings: Heavy Atoms: 23QED Weighted: 0.27Np Likeness Score: -0.12

References

1. Galaka T, Falcone BN, Li C, Szajnman SH, Moreno SNJ, Docampo R, Rodriguez JB..  (2019)  Synthesis and biological evaluation of 1-alkylaminomethyl-1,1-bisphosphonic acids against Trypanosoma cruzi and Toxoplasma gondii.,  27  (16): [PMID:31296439] [10.1016/j.bmc.2019.07.004]

Source