(S)-4-((S)-2-((S)-2-Acetamido-3-phenylpropanamido)-propanamido)-5-amino-5-oxopentanoic Acid

ID: ALA4450908

PubChem CID: 155522118

Max Phase: Preclinical

Molecular Formula: C19H26N4O6

Molecular Weight: 406.44

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(=O)O)C(N)=O

Standard InChI:  InChI=1S/C19H26N4O6/c1-11(18(28)23-14(17(20)27)8-9-16(25)26)21-19(29)15(22-12(2)24)10-13-6-4-3-5-7-13/h3-7,11,14-15H,8-10H2,1-2H3,(H2,20,27)(H,21,29)(H,22,24)(H,23,28)(H,25,26)/t11-,14-,15-/m0/s1

Standard InChI Key:  HNDKTEVSYZJHEN-CQDKDKBSSA-N

Molfile:  

 
     RDKit          2D

 29 29  0  0  0  0  0  0  0  0999 V2000
    3.0014  -21.1395    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7108  -20.7309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4161  -21.9567    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4161  -21.1395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7108  -19.9138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2920  -19.9138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0014  -19.5052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0014  -18.6880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2920  -18.2794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5867  -18.6880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5867  -19.5052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1255  -20.7309    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8308  -21.1395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5402  -19.9138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8308  -21.9567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5402  -20.7309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2496  -21.1395    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9549  -20.7309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6643  -21.9567    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6643  -21.1395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9549  -19.9138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6643  -19.5052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6643  -18.6880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9549  -18.2794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3696  -18.2794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3696  -20.7309    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0014  -21.9567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7108  -22.3653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2920  -22.3653    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  4 12  1  0
 16 17  1  0
 20 26  1  0
  1  2  1  0
  2  4  1  0
  4  3  2  0
  2  5  1  1
  5  7  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
 12 13  1  0
 13 16  1  0
 16 14  2  0
 13 15  1  6
 17 18  1  0
 18 20  1  0
 20 19  2  0
 18 21  1  1
 21 22  1  0
 22 23  1  0
 23 24  2  0
 23 25  1  0
  1 27  1  0
 27 28  1  0
 27 29  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4450908

    ---

Associated Targets(non-human)

Tlr4 Toll-like receptor 4 (76 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 406.44Molecular Weight (Monoisotopic): 406.1852AlogP: -0.93#Rotatable Bonds: 11
Polar Surface Area: 167.69Molecular Species: ACIDHBA: 5HBD: 5
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.05CX Basic pKa: CX LogP: -1.34CX LogD: -4.46
Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.32Np Likeness Score: 0.02

References

1. Trifonov L, Nudelman V, Zhenin M, Matsree E, Afri M, Schmerling B, Cohen G, Jozwiak K, Weitman M, Korshin E, Senderowitz H, Shainberg A, Hochhauser E, Gruzman A..  (2018)  Structurally Simple, Readily Available Peptidomimetic 1-Benzyl-5-methyl-4-( n-octylamino)pyrimidin-2(1 H)-one Exhibited Efficient Cardioprotection in a Myocardial Ischemia (MI) Mouse Model.,  61  (24): [PMID:30507195] [10.1021/acs.jmedchem.8b01471]

Source