The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-[3-(4-Cyano-benzoylamino)-2,2-dimethyl-5-phenyl-pentanoylamino]-3-phenyl-propionic acid ethyl ester ID: ALA445116
PubChem CID: 10839830
Max Phase: Preclinical
Molecular Formula: C32H35N3O4
Molecular Weight: 525.65
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)[C@H](Cc1ccccc1)NC(=O)C(C)(C)C(CCc1ccccc1)NC(=O)c1ccc(C#N)cc1
Standard InChI: InChI=1S/C32H35N3O4/c1-4-39-30(37)27(21-24-13-9-6-10-14-24)34-31(38)32(2,3)28(20-17-23-11-7-5-8-12-23)35-29(36)26-18-15-25(22-33)16-19-26/h5-16,18-19,27-28H,4,17,20-21H2,1-3H3,(H,34,38)(H,35,36)/t27-,28?/m0/s1
Standard InChI Key: ZFIWICASXLPGPI-MBMZGMDYSA-N
Molfile:
RDKit 2D
39 41 0 0 1 0 0 0 0 0999 V2000
4.8167 -9.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5292 -9.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6792 -9.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2417 -9.7542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3917 -9.7667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1042 -9.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9542 -9.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6667 -9.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8875 -11.4167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1708 -11.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9667 -9.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5250 -8.5250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6750 -8.5292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9500 -8.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6667 -10.5792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1000 -8.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9667 -10.5875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2500 -9.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5417 -10.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3792 -9.3375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2250 -10.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4000 -10.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8125 -8.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2542 -11.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5375 -9.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6625 -8.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8125 -7.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0917 -9.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3750 -8.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6542 -7.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5250 -6.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1000 -6.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8042 -9.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0917 -8.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3667 -6.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5250 -6.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0917 -6.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8042 -5.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0875 -7.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 5 1 0
4 2 1 0
5 6 1 0
6 1 1 0
7 4 1 0
8 7 1 0
9 10 3 0
10 19 1 0
11 3 1 0
12 2 2 0
13 3 2 0
7 14 1 1
15 8 2 0
16 6 1 0
17 11 1 0
18 11 2 0
19 25 2 0
20 8 1 0
21 1 1 0
22 1 1 0
23 16 1 0
24 17 2 0
25 18 1 0
26 14 1 0
27 23 1 0
28 20 1 0
29 26 2 0
30 26 1 0
31 27 2 0
32 27 1 0
33 28 1 0
34 29 1 0
35 30 2 0
36 31 1 0
37 32 2 0
38 37 1 0
39 35 1 0
19 24 1 0
38 36 2 0
39 34 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 525.65Molecular Weight (Monoisotopic): 525.2628AlogP: 4.61#Rotatable Bonds: 12Polar Surface Area: 108.29Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.17CX Basic pKa: ┄CX LogP: 5.86CX LogD: 5.86Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.34Np Likeness Score: -0.54
References 1. Iijima K, Katada J, Yasuda E, Uno I, Hayashi Y.. (1999) N-[2,2-dimethyl-3-(N-(4-cyanobenzoyl)amino)nonanoyl]-L-phenylalanine ethyl ester as a stable ester-type inhibitor of chymotrypsin-like serine proteases: structural requirements for potent inhibition of alpha-chymotrypsin., 42 (2): [PMID:9925737 ] [10.1021/jm980562h ]