The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(((Z)-(1-(2-aminothiazol-4-yl)-2-(((2S,3S)-1-(((5-ethoxy-2,2-dimethyl-5-oxopentyl)oxy)sulfonyl)-2-methyl-4-oxoazetidin-3-yl)amino)-2-oxoethylidene)amino)oxy)-2-methylpropanoic acid Trifluoro acetic acid ID: ALA4451324
PubChem CID: 155522303
Max Phase: Preclinical
Molecular Formula: C24H34F3N5O12S2
Molecular Weight: 591.67
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)CCC(C)(C)COS(=O)(=O)N1C(=O)[C@@H](NC(=O)/C(=N\OC(C)(C)C(=O)O)c2csc(N)n2)[C@@H]1C.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C22H33N5O10S2.C2HF3O2/c1-7-35-14(28)8-9-21(3,4)11-36-39(33,34)27-12(2)15(18(27)30)25-17(29)16(13-10-38-20(23)24-13)26-37-22(5,6)19(31)32;3-2(4,5)1(6)7/h10,12,15H,7-9,11H2,1-6H3,(H2,23,24)(H,25,29)(H,31,32);(H,6,7)/b26-16-;/t12-,15-;/m0./s1
Standard InChI Key: BKUVBWVNXSVLFI-MHTSGDOLSA-N
Molfile:
RDKit 2D
46 46 0 0 0 0 0 0 0 0999 V2000
14.0074 -14.7074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7261 -14.2949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4446 -14.7074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7261 -13.4658 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2889 -14.2949 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.0074 -15.5365 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.2866 -15.1199 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.2743 -19.1446 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8660 -18.4322 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.4531 -19.1420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5909 -17.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0075 -18.0155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4198 -17.2964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7580 -17.2489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5580 -17.4655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3457 -16.6645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3328 -17.1989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3328 -18.0239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1577 -18.0239 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1577 -17.1989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7494 -18.6072 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7410 -16.6155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7494 -16.6155 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9526 -16.8291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3692 -16.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7391 -17.6259 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5827 -15.4489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5724 -16.4593 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3589 -17.2561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3485 -18.2665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5517 -18.4800 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9319 -18.8498 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3487 -15.1550 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3056 -14.3312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5087 -14.1177 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.0595 -14.8096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9466 -13.8121 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5802 -18.0192 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2948 -18.4312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7237 -18.4303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4387 -18.0188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1526 -18.4323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8675 -18.0209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1514 -19.2573 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5814 -18.4342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2964 -18.0227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
1 5 1 0
1 6 1 0
1 7 1 0
9 8 2 0
10 9 2 0
12 11 1 0
13 12 1 0
15 14 1 0
16 15 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 17 1 0
18 21 2 0
20 22 1 6
17 23 1 1
23 24 1 0
24 25 1 0
24 26 2 0
25 27 1 0
25 28 2 0
28 29 1 0
29 15 1 0
15 30 1 0
30 31 1 0
30 32 2 0
27 33 1 0
33 34 2 0
34 35 1 0
35 36 1 0
36 27 2 0
34 37 1 0
19 9 1 0
9 38 1 0
38 39 1 0
39 12 1 0
12 40 1 0
40 41 1 0
41 42 1 0
42 43 1 0
42 44 2 0
43 45 1 0
45 46 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 591.67Molecular Weight (Monoisotopic): 591.1669AlogP: 0.66#Rotatable Bonds: 14Polar Surface Area: 216.88Molecular Species: ACIDHBA: 13HBD: 3#RO5 Violations: 2HBA (Lipinski): 15HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 2.87CX Basic pKa: 3.91CX LogP: 1.05CX LogD: -1.67Aromatic Rings: 1Heavy Atoms: 39QED Weighted: 0.12Np Likeness Score: 0.11
References 1. Gordon EM, Duncton MAJ, Wang BJ, Qi L, Fan D, Li X, Ni ZJ, Ding P, Grygorash R, Low E, Yu G, Sun J.. (2020) Toward Orally Absorbed Prodrugs of the Antibiotic Aztreonam. Design of Novel Prodrugs of Sulfate Containing Drugs. Part 2., 11 (2): [PMID:32071683 ] [10.1021/acsmedchemlett.9b00534 ]