2-((bis(2-chloroethyl)amino)(4-(trifluoromethyl)phenyl)methyl)-1,4-dihydroxyanthracene-9,10-dione

ID: ALA4451416

PubChem CID: 141750637

Max Phase: Preclinical

Molecular Formula: C26H20Cl2F3NO4

Molecular Weight: 538.35

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1c2ccccc2C(=O)c2c(O)c(C(c3ccc(C(F)(F)F)cc3)N(CCCl)CCCl)cc(O)c21

Standard InChI:  InChI=1S/C26H20Cl2F3NO4/c27-9-11-32(12-10-28)22(14-5-7-15(8-6-14)26(29,30)31)18-13-19(33)20-21(25(18)36)24(35)17-4-2-1-3-16(17)23(20)34/h1-8,13,22,33,36H,9-12H2

Standard InChI Key:  VCQUKWNHAWUDJI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
    5.6291  -14.9158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6291  -13.2814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9238  -14.5113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9263  -13.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2226  -13.2879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5158  -13.6940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5172  -14.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2215  -14.9169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3343  -13.6941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3327  -14.5095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0370  -14.9168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7433  -14.5099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7409  -13.6914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0361  -13.2878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6276  -12.4642    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6303  -15.7330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0363  -15.7340    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0341  -12.4706    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4473  -13.2805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4447  -12.4633    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1528  -13.6859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1541  -14.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8622  -14.9104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5696  -14.4995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5644  -13.6781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8556  -13.2755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2792  -14.9049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1511  -12.0525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7357  -12.0570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7331  -11.2398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0240  -10.8335    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.1485  -11.2353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8549  -10.8244    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   11.9281  -15.2711    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.4226  -15.7447    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.0794  -14.5951    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  4  2  1  0
  3  1  1  0
  1 10  1  0
  9  2  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  2 15  2  0
  1 16  2  0
 11 17  1  0
 14 18  1  0
 13 19  1  0
 19 20  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 19 21  1  0
 24 27  1  0
 20 28  1  0
 20 29  1  0
 29 30  1  0
 30 31  1  0
 28 32  1  0
 32 33  1  0
 27 34  1  0
 27 35  1  0
 27 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4451416

    ---

Associated Targets(Human)

TOP2A Tclin DNA topoisomerase II (1334 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
L02 (4864 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 538.35Molecular Weight (Monoisotopic): 537.0721AlogP: 5.76#Rotatable Bonds: 7
Polar Surface Area: 77.84Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.85CX Basic pKa: 4.00CX LogP: 7.54CX LogD: 7.41
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.23Np Likeness Score: 0.06

References

1. Liu Y, Liang Y, Jiang J, Qin Q, Wang L, Liu X..  (2019)  Design, synthesis and biological evaluation of 1,4-dihydroxyanthraquinone derivatives as anticancer agents.,  29  (9): [PMID:30846253] [10.1016/j.bmcl.2019.02.026]

Source