5-chloro-N4-(2-isopropylsulfonylphenyl)-N2-[5-methyl-2-(1,1,2,2,2-pentadeuterioethoxy)-4-(4-piperidyl)phenyl]pyrimidine-2,4-diamine

ID: ALA4451829

PubChem CID: 155521645

Max Phase: Preclinical

Molecular Formula: C27H34ClN5O3S

Molecular Weight: 544.12

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  [2H]C([2H])([2H])C([2H])([2H])Oc1cc(C2CCNCC2)c(C)cc1Nc1ncc(Cl)c(Nc2ccccc2S(=O)(=O)C(C)C)n1

Standard InChI:  InChI=1S/C27H34ClN5O3S/c1-5-36-24-15-20(19-10-12-29-13-11-19)18(4)14-23(24)32-27-30-16-21(28)26(33-27)31-22-8-6-7-9-25(22)37(34,35)17(2)3/h6-9,14-17,19,29H,5,10-13H2,1-4H3,(H2,30,31,32,33)/i1D3,5D2

Standard InChI Key:  UPTWBUUDINOIEZ-RPIBLTHZSA-N

Molfile:  

 
     RDKit          2D

 42 45  0  0  0  0  0  0  0  0999 V2000
   14.4824   -4.9403    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.0780   -4.2345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6690   -4.9377    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   20.0253   -3.0954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4380   -3.8053    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.8465   -3.0929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4963   -4.2345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4952   -5.0540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2032   -5.4630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9129   -5.0536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9101   -4.2309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2014   -3.8256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2030   -6.2802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4940   -6.6825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4918   -7.4961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1976   -7.9087    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9072   -7.5015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9110   -6.6817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6212   -5.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1990   -3.0084    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9055   -2.5977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6123   -3.0066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.3183   -2.5966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3163   -1.7785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6024   -1.3722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8993   -1.7846    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.0270   -3.0034    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.0222   -1.3669    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   19.0291   -3.8206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3213   -4.2254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3230   -5.0419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0323   -5.4495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7413   -5.0348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7361   -4.2197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1515   -4.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8553   -3.7931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1592   -5.0255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7885   -3.8261    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3731   -3.8264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6649   -4.2341    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.3741   -3.0092    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.6623   -3.4173    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  2  0
  6  5  2  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  9 13  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 10 19  1  0
 12 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 23 27  1  0
 24 28  1  0
 27 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 34  5  1  0
  5 35  1  0
 35 36  1  0
 35 37  1  0
  7 38  1  0
 38  2  1  0
  2 39  1  0
 39 40  1  0
 39 41  1  0
 39 42  1  0
M  ISO  5   1   2   3   2  40   2  41   2  42   2
M  END

Associated Targets(Human)

NCI-H2228 (1030 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NCI-H3122 (436 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ALK Tclin ALK tyrosine kinase receptor (7132 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 544.12Molecular Weight (Monoisotopic): 543.2071AlogP: 5.97#Rotatable Bonds: 9
Polar Surface Area: 105.24Molecular Species: BASEHBA: 8HBD: 3
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.58CX Basic pKa: 10.07CX LogP: 5.39CX LogD: 2.96
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.30Np Likeness Score: -1.24

References

1. Das D, Wang J, Li Y, Shi J, Hong J..  (2019)  Design, synthesis of orally bioavailable novel anaplastic lymphoma kinase (ALK) inhibitor diphenylaminopyrimidine analogs and efficacy study on NCI-H2228 xenografts mice model.,  29  (12): [PMID:31005443] [10.1016/j.bmcl.2019.04.012]

Source