The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Baraphenazine G ID: ALA4452016
PubChem CID: 145721018
Max Phase: Preclinical
Molecular Formula: C25H16N4O6
Molecular Weight: 468.43
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1cc2c(c3nc4cccc(O)c4nc13)[C@@H]1Cc3nc4cccc(O)c4nc3[C@@](O)(C1)O2
Standard InChI: InChI=1S/C25H16N4O6/c30-15-5-2-4-13-20(15)28-19-11(24(32)33)8-17-18(22(19)27-13)10-7-14-23(25(34,9-10)35-17)29-21-12(26-14)3-1-6-16(21)31/h1-6,8,10,30-31,34H,7,9H2,(H,32,33)/t10-,25-/m1/s1
Standard InChI Key: IKZAYRLYTAVSAG-REFGNXHDSA-N
Molfile:
RDKit 2D
36 42 0 0 0 0 0 0 0 0999 V2000
26.4070 -3.5935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4051 -4.4263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1216 -4.8394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1230 -3.1805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8403 -3.5921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8373 -4.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5586 -4.8343 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.5500 -3.1771 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.1193 -2.3514 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.2681 -3.5859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2707 -4.4139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9888 -4.8263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9834 -3.1660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7043 -3.5812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4151 -4.8165 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
29.9777 -2.3374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.6943 -2.7457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.6860 -4.3915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4053 -3.1581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4026 -3.9831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1160 -2.7479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8260 -3.1599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8297 -3.9854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1156 -4.3932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1128 -5.2137 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.5375 -4.3954 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.5381 -5.2145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8223 -5.6251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8210 -6.4484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5347 -6.8622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2512 -6.4466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2490 -5.6246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5399 -2.7465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2549 -3.1581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.5389 -1.9215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.9628 -5.2110 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 11 2 0
10 8 2 0
8 5 1 0
4 9 1 0
10 11 1 0
10 13 1 0
11 12 1 0
12 18 1 0
14 13 1 0
14 18 1 0
18 15 1 1
13 16 1 1
13 17 1 0
17 19 1 0
20 18 1 0
19 20 2 0
20 24 1 0
23 22 1 0
21 19 1 0
21 22 2 0
23 24 1 0
24 25 2 0
25 28 1 0
27 26 1 0
26 23 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 27 2 0
22 33 1 0
33 34 1 0
33 35 2 0
32 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.43Molecular Weight (Monoisotopic): 468.1070AlogP: 3.10#Rotatable Bonds: 1Polar Surface Area: 158.78Molecular Species: ACIDHBA: 9HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.66CX Basic pKa: 2.00CX LogP: 3.15CX LogD: -0.14Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.27Np Likeness Score: 0.67
References 1. Wang X, Abbas M, Zhang Y, Elshahawi SI, Ponomareva LV, Cui Z, Van Lanen SG, Sajid I, Voss SR, Shaaban KA, Thorson JS.. (2019) Baraphenazines A-G, Divergent Fused Phenazine-Based Metabolites from a Himalayan Streptomyces., 82 (6): [PMID:31117525 ] [10.1021/acs.jnatprod.9b00289 ]