The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-methoxy-4-(5-(4-(5-m-tolyl-1,3,4-thiadiazol-2-yl)phenyl)-1,3,4-oxadiazol-2-yl)phenol ID: ALA4452313
PubChem CID: 155523012
Max Phase: Preclinical
Molecular Formula: C24H18N4O3S
Molecular Weight: 442.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(O)ccc1-c1nnc(-c2ccc(-c3nnc(-c4cccc(C)c4)s3)cc2)o1
Standard InChI: InChI=1S/C24H18N4O3S/c1-14-4-3-5-17(12-14)24-28-27-23(32-24)16-8-6-15(7-9-16)21-25-26-22(31-21)19-11-10-18(29)13-20(19)30-2/h3-13,29H,1-2H3
Standard InChI Key: SJILNTOSBXNFBF-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
26.3840 -23.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3828 -23.9237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0909 -24.3327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8005 -23.9233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7977 -23.1006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0891 -22.6953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6748 -24.3318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.0866 -21.8781 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.3777 -21.4717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5016 -22.6910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2494 -23.0205 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.7939 -22.4112 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.3826 -21.7050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5262 -21.8780 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.7091 -20.9591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5227 -20.8718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8522 -20.1248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3692 -19.4646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5529 -19.5562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2271 -20.3034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6941 -18.7179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4925 -18.5438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.5737 -17.7307 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.8254 -17.4021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2818 -17.9834 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.6609 -16.6017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2729 -16.0615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1090 -15.2617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3328 -15.0032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7204 -15.5506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8875 -16.3484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7203 -14.7193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
6 8 1 0
8 9 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 10 1 0
5 10 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
13 15 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 21 1 0
18 21 1 0
24 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
28 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.50Molecular Weight (Monoisotopic): 442.1100AlogP: 5.61#Rotatable Bonds: 5Polar Surface Area: 94.16Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.53CX Basic pKa: 0.05CX LogP: 4.88CX LogD: 4.85Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.38Np Likeness Score: -0.81
References 1. Taha M, Imran S, Alomari M, Rahim F, Wadood A, Mosaddik A, Uddin N, Gollapalli M, Alqahtani MA, Bamarouf YA.. (2019) Synthesis of oxadiazole-coupled-thiadiazole derivatives as a potent β-glucuronidase inhibitors and their molecular docking study., 27 (14): [PMID:31196753 ] [10.1016/j.bmc.2019.05.049 ]