The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
trans-2,3-Bis(benzyloxy)-13-ethyl-8-propyl-8,9,11,13a-tetrahydro-5H-azocino[2,1-a]isoquinolin-10(6H)-one ID: ALA4452564
PubChem CID: 155522700
Max Phase: Preclinical
Molecular Formula: C34H39NO3
Molecular Weight: 509.69
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC[C@@H]1CC(=O)C/C=C(/CC)[C@H]2c3cc(OCc4ccccc4)c(OCc4ccccc4)cc3CCN12
Standard InChI: InChI=1S/C34H39NO3/c1-3-11-29-21-30(36)17-16-27(4-2)34-31-22-33(38-24-26-14-9-6-10-15-26)32(20-28(31)18-19-35(29)34)37-23-25-12-7-5-8-13-25/h5-10,12-16,20,22,29,34H,3-4,11,17-19,21,23-24H2,1-2H3/b27-16-/t29-,34+/m1/s1
Standard InChI Key: MTXATHAGQQVLNQ-SLCQVZADSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
8.1675 -6.3112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5381 -7.8650 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.0246 -7.1549 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4670 -7.5446 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6094 -8.3399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0708 -3.4140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1193 -6.8380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0490 -8.3399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3295 -7.0928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4849 -9.0584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6060 -6.3115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0755 -8.3491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8866 -5.8961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4680 -5.0767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2993 -7.5551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3507 -3.8297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6292 -9.3799 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3048 -5.9081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8030 -7.3738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1675 -7.1401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9820 -8.8726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2729 -9.2821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7908 -3.8296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3292 -8.7556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5900 -7.1455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6094 -7.5087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0490 -7.5332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3507 -4.6610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8834 -7.5536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7480 -7.1295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2657 -8.4471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7691 -4.6733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0706 -5.0766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4680 -5.9074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0246 -6.3237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2115 -8.0815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3064 -6.7259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6208 -6.1928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9451 -9.1988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21 17 2 0
27 8 2 0
19 37 1 6
8 24 1 0
1 13 1 0
10 22 1 0
34 14 1 0
19 36 1 0
33 28 1 0
15 3 1 0
1 34 1 0
22 21 1 0
12 10 2 0
3 19 1 0
16 6 1 0
37 7 1 0
20 4 1 0
35 3 1 0
29 20 1 0
27 9 1 0
14 32 1 0
11 18 1 0
20 1 2 0
13 11 2 0
25 11 1 0
15 25 1 0
6 23 2 0
25 29 2 0
36 21 1 0
28 16 2 0
30 27 1 0
4 30 1 0
24 5 2 0
15 2 1 6
5 26 1 0
32 33 2 0
18 35 1 0
12 15 1 0
32 23 1 0
26 9 2 0
31 12 1 0
7 38 1 0
31 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 509.69Molecular Weight (Monoisotopic): 509.2930AlogP: 7.61#Rotatable Bonds: 9Polar Surface Area: 38.77Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.06CX LogP: 7.73CX LogD: 6.98Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.28Np Likeness Score: 0.37
References 1. Zheng H, Dong Y, Li L, Sun B, Liu L, Yuan H, Lou H.. (2016) Novel Benzo[a]quinolizidine Analogs Induce Cancer Cell Death through Paraptosis and Apoptosis., 59 (10): [PMID:27077446 ] [10.1021/acs.jmedchem.6b00484 ]