The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(pyridin-2-yl)-N-(5-(1-(6-(2-(3-(trifluoromethoxy)phenyl)acetamido)pyridazin-3-yl)piperidin-4-yl)-1,3,4-thiadiazol-2-yl)acetamide ID: ALA4452754
PubChem CID: 91820682
Max Phase: Preclinical
Molecular Formula: C27H25F3N8O3S
Molecular Weight: 598.61
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Cc1cccc(OC(F)(F)F)c1)Nc1ccc(N2CCC(c3nnc(NC(=O)Cc4ccccn4)s3)CC2)nn1
Standard InChI: InChI=1S/C27H25F3N8O3S/c28-27(29,30)41-20-6-3-4-17(14-20)15-23(39)32-21-7-8-22(35-34-21)38-12-9-18(10-13-38)25-36-37-26(42-25)33-24(40)16-19-5-1-2-11-31-19/h1-8,11,14,18H,9-10,12-13,15-16H2,(H,32,34,39)(H,33,37,40)
Standard InChI Key: HFYUNFAPRLIYMV-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
29.0185 -3.5715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8380 -3.5726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2491 -2.8681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8376 -2.1579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0149 -2.1607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6117 -2.8699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7904 -2.8724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.3755 -2.1617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5542 -2.1642 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.7861 -1.4487 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26.9591 -1.4445 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.2502 -4.2848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0715 -4.2854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4795 -4.9976 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.4807 -3.5739 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.3020 -3.5746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7101 -4.2898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5307 -4.2908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9407 -3.5788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5282 -2.8684 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.7090 -2.8709 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.7620 -3.5783 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.1715 -4.2931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9893 -4.2946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4013 -3.5843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9935 -2.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1696 -2.8719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2226 -3.5870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7032 -4.2506 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
38.4853 -4.0006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4880 -3.1792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.7075 -2.9243 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.1922 -4.4079 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.9006 -4.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6117 -4.4103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9020 -3.1792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.3242 -4.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0306 -4.4159 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.7426 -4.0092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7445 -3.1870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0283 -2.7732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3192 -3.1864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 1 0
8 10 1 0
8 11 1 0
2 12 1 0
12 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
22 23 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
25 28 1 0
28 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 28 2 0
30 33 1 0
33 34 1 0
34 35 1 0
34 36 2 0
35 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 598.61Molecular Weight (Monoisotopic): 598.1722AlogP: 4.37#Rotatable Bonds: 9Polar Surface Area: 135.12Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.93CX Basic pKa: 4.34CX LogP: 4.67CX LogD: 4.13Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.29Np Likeness Score: -2.19
References 1. Zimmermann SC, Duvall B, Tsukamoto T.. (2018) Recent Progress in the Discovery of Allosteric Inhibitors of Kidney-Type Glutaminase., 62 (1): [PMID:29969024 ] [10.1021/acs.jmedchem.8b00327 ]