7-((1R,2S,3E,5Z)-8-(3,4-dichlorophenoxy)-1-hydroxy-1-(3-(trifluoromethyl)phenyl)octa-3,5-dien-2-ylthio)-4-oxo-4H-chromene-2-carboxylic acid

ID: ALA4452785

PubChem CID: 155522895

Max Phase: Preclinical

Molecular Formula: C31H23Cl2F3O6S

Molecular Weight: 651.49

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)c1cc(=O)c2ccc(S[C@@H](/C=C/C=C\CCOc3ccc(Cl)c(Cl)c3)[C@H](O)c3cccc(C(F)(F)F)c3)cc2o1

Standard InChI:  InChI=1S/C31H23Cl2F3O6S/c32-23-12-9-20(15-24(23)33)41-13-4-2-1-3-8-28(29(38)18-6-5-7-19(14-18)31(34,35)36)43-21-10-11-22-25(37)17-27(30(39)40)42-26(22)16-21/h1-3,5-12,14-17,28-29,38H,4,13H2,(H,39,40)/b2-1-,8-3+/t28-,29+/m0/s1

Standard InChI Key:  MGBCYGLRUZPXSX-RRMDEAQUSA-N

Molfile:  

 
     RDKit          2D

 43 46  0  0  0  0  0  0  0  0999 V2000
   10.5627   -9.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1378   -9.0115    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6470   -7.3042    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.2777   -9.4065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0003  -10.6282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0126   -9.4380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5843  -10.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3982   -8.1592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7057  -10.2161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0996   -6.9247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5364   -9.3758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2641   -7.7665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4042   -8.9802    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.9420   -7.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6568   -8.1173    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.6199  -13.1095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5567   -8.1801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3117  -11.8696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0174  -11.4465    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9331   -6.8957    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.5952  -11.4687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0406  -13.0881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9847   -8.9895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8190   -8.1488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0181  -10.2597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6849   -7.7561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7455  -11.4836    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   11.2838  -10.2315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8198   -8.9686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3240  -12.6905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2448   -8.9580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2361   -8.1328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5230   -7.7334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3088  -10.6743    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.7365  -10.6628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8553   -9.4188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1057   -7.7457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9775   -8.1696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7195   -9.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4405  -10.2475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4305   -9.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6969   -9.3979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8710  -10.2499    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 35 27  1  0
 26  8  1  0
 14 20  1  0
  8 37  1  0
 42 23  2  0
 14  3  1  0
 36  1  1  0
 37 10  1  6
 36  2  1  0
 40 41  1  0
 28  7  1  0
 24 29  2  0
 23  4  1  0
  9  5  2  0
 18 30  1  0
  2 41  1  0
 29 11  1  0
 14 15  1  0
 25 35  1  0
 18 19  1  0
 39  6  1  0
 11 31  2  0
 35 40  2  0
  7 21  1  0
  5 28  1  0
  5 19  1  0
 25 34  1  0
 30 16  1  0
  4 28  2  0
 13 42  1  0
  8 13  1  1
 12 38  1  0
 31 32  1  0
 38 26  2  0
 17 12  2  0
  9 42  1  0
 32 33  2  0
 37 24  1  0
 30 22  2  0
  1 17  1  0
 32 14  1  0
 33 24  1  0
 41 39  2  0
  6 25  2  0
 21 18  2  0
  7 43  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4452785

    ---

Associated Targets(non-human)

BHK-21 (725 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
dengue virus type 2 (2400 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 651.49Molecular Weight (Monoisotopic): 650.0544AlogP: 8.59#Rotatable Bonds: 11
Polar Surface Area: 96.97Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 1.98CX Basic pKa: CX LogP: 7.87CX LogD: 4.34
Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.10Np Likeness Score: -0.16

References

1. Behnam MA, Nitsche C, Boldescu V, Klein CD..  (2016)  The Medicinal Chemistry of Dengue Virus.,  59  (12): [PMID:26771861] [10.1021/acs.jmedchem.5b01653]

Source