3-(4'-((2-butyl-4-methyl-5-((3-methyl-1,2,4-oxadiazol-5-yl)methyl)-6-oxopyrimidin-1(6H)-yl)methyl)biphenyl-2-yl)-1,2,4-oxadiazol-5(4H)-one

ID: ALA4453209

PubChem CID: 153392717

Max Phase: Preclinical

Molecular Formula: C28H28N6O4

Molecular Weight: 512.57

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCc1nc(C)c(Cc2nc(C)no2)c(=O)n1Cc1ccc(-c2ccccc2-c2noc(=O)[nH]2)cc1

Standard InChI:  InChI=1S/C28H28N6O4/c1-4-5-10-24-29-17(2)23(15-25-30-18(3)32-37-25)27(35)34(24)16-19-11-13-20(14-12-19)21-8-6-7-9-22(21)26-31-28(36)38-33-26/h6-9,11-14H,4-5,10,15-16H2,1-3H3,(H,31,33,36)

Standard InChI Key:  IBJPTOYIKBAOQN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   28.9028   -7.8199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1103   -7.6053    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.6613   -8.2926    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.1763   -8.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9434   -8.6398    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.9070   -2.9307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9029   -3.7479    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.6788   -4.0044    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.1626   -3.3457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6855   -2.6822    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.4901   -5.3695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4889   -6.1890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1970   -6.5980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9066   -6.1885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9038   -5.3659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1952   -4.9606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6150   -6.5960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6114   -7.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3189   -7.8210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0270   -7.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0230   -6.5898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3150   -6.1861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7822   -4.9611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7820   -4.1439    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.4916   -3.7368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4933   -2.9232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7874   -2.5110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0779   -2.9185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.0745   -3.7383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1983   -4.1472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.3666   -4.1465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6591   -3.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9512   -4.1458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2437   -3.7368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2025   -2.5171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9798   -3.3497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9627   -9.7208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.7903   -1.6938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  6  2  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 14 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 11 23  1  0
 23 24  1  0
 24 25  1  0
 24 29  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 25 30  2  0
 29 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 26 35  1  0
 35  6  1  0
  9 36  1  0
 18  1  1  0
  4 37  2  0
 27 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4453209

    ---

Associated Targets(non-human)

Pparg Peroxisome proliferator-activated receptor gamma (748 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 512.57Molecular Weight (Monoisotopic): 512.2172AlogP: 4.24#Rotatable Bonds: 9
Polar Surface Area: 132.70Molecular Species: ACIDHBA: 9HBD: 1
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 5.91CX Basic pKa: 1.89CX LogP: 5.06CX LogD: 4.12
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.31Np Likeness Score: -1.38

References

1. Choung W, Yang D, Kim H, Choi H, Lee BR, Park M, Jang SM, Lim JS, Kim WS, Kim KH, Chin J, Jung K, Lee G, Hong E, Jang TH, Joo J, Hwang H, Myung J, Kim SH..  (2019)  Discovery of BR102375, a new class of non-TZD PPARγ full agonist for the treatment of type 2 diabetes.,  29  (16): [PMID:31253533] [10.1016/j.bmcl.2019.06.027]

Source