The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Gastropolybenzylol E ID: ALA4453769
PubChem CID: 155522686
Max Phase: Preclinical
Molecular Formula: C23H24O4
Molecular Weight: 364.44
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOCc1ccc(O)c(Cc2ccc(O)c(Cc3ccc(O)cc3)c2)c1
Standard InChI: InChI=1S/C23H24O4/c1-2-27-15-18-6-10-23(26)20(14-18)13-17-5-9-22(25)19(12-17)11-16-3-7-21(24)8-4-16/h3-10,12,14,24-26H,2,11,13,15H2,1H3
Standard InChI Key: VFURDENLYWKYCA-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
28.0885 -7.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0874 -8.6654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7995 -9.0785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5133 -8.6649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5105 -7.8381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7977 -7.4328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3752 -9.0775 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.2208 -7.4268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9341 -7.8328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9339 -8.6517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6464 -9.0617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3536 -8.6463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3479 -7.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6389 -7.4186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0567 -7.4070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2227 -9.0655 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.7715 -7.8104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7722 -8.6311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4862 -9.0386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1960 -8.6207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1873 -7.7952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4728 -7.3955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0619 -9.0466 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.8947 -7.3789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6109 -7.7798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.3183 -7.3636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0304 -7.7645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
5 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
13 15 1 0
10 16 1 0
15 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
18 23 1 0
21 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 364.44Molecular Weight (Monoisotopic): 364.1675AlogP: 4.52#Rotatable Bonds: 7Polar Surface Area: 69.92Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.38CX Basic pKa: ┄CX LogP: 5.48CX LogD: 5.47Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.58Np Likeness Score: 0.28
References 1. Chen SY, Geng CA, Ma YB, Huang XY, Yang XT, Su LH, He XF, Li TZ, Deng ZT, Gao Z, Zhang XM, Chen JJ.. (2019) Polybenzyls from Gastrodia elata, their agonistic effects on melatonin receptors and structure-activity relationships., 27 (15): [PMID:31204226 ] [10.1016/j.bmc.2019.06.008 ]