The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-((5-(hydroxymethyl)-3-(4-phenoxyphenyl)-1H-pyrazol-1-yl)methyl)phenyl)acrylamide ID: ALA4453935
PubChem CID: 141741238
Max Phase: Preclinical
Molecular Formula: C26H23N3O3
Molecular Weight: 425.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cccc(Cn2nc(-c3ccc(Oc4ccccc4)cc3)cc2CO)c1
Standard InChI: InChI=1S/C26H23N3O3/c1-2-26(31)27-21-8-6-7-19(15-21)17-29-22(18-30)16-25(28-29)20-11-13-24(14-12-20)32-23-9-4-3-5-10-23/h2-16,30H,1,17-18H2,(H,27,31)
Standard InChI Key: XAFRKKVPGQDIBR-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
12.8962 -16.5481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5631 -17.0203 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2195 -16.5334 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9571 -15.7568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1409 -15.7696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5691 -17.8382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2811 -18.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4282 -15.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2430 -15.1658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7140 -14.4989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3715 -13.7560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5532 -13.6840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0858 -14.3518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8418 -13.0878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6557 -13.1610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9954 -13.9062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8086 -13.9797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2798 -13.3109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9320 -12.5668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1199 -12.4969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1218 -16.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5086 -16.2689 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2884 -19.0510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9996 -19.4494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7016 -19.0319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6879 -18.2119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9763 -17.8173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0102 -20.2665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3078 -20.6842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3184 -21.5014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5949 -20.2848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6160 -21.9191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 2 0
6 7 1 0
6 2 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
4 8 1 0
11 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
1 21 1 0
21 22 1 0
7 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 7 1 0
24 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
30 32 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 425.49Molecular Weight (Monoisotopic): 425.1739AlogP: 5.01#Rotatable Bonds: 8Polar Surface Area: 76.38Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 1.86CX LogP: 4.81CX LogD: 4.81Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.39Np Likeness Score: -1.12
References 1. Ran F, Liu Y, Zhang D, Liu M, Zhao G.. (2019) Discovery of novel pyrazole derivatives as potential anticancer agents in MCL., 29 (9): [PMID:30857748 ] [10.1016/j.bmcl.2019.03.005 ]